Preferred Name |
carbamic acid |
|
Synonyms |
CARBAMIC ACID carbamic acid Carbamic acid Carbamate Aminoameisensaeure Carbamidsaeure Aminoformic acid |
|
Definitions |
A one-carbon compound that is ammonia in which one of the hydrogens is replaced by a carboxy group. Although carbamic acid derivatives are common, carbamic acid itself has never been synthesised. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_28616 |
|
charge |
0 |
|
database_cross_reference |
CAS:463-77-4 PDBeChem:OUT DrugBank:DB04261 Wikipedia:Carbamic_acid KEGG:C01563 Gmelin:130345 Beilstein:1734754 |
|
definition |
A one-carbon compound that is ammonia in which one of the hydrogens is replaced by a carboxy group. Although carbamic acid derivatives are common, carbamic acid itself has never been synthesised. |
|
formula |
CH3NO2 |
|
has role | ||
has_alternative_id |
CHEBI:44573 CHEBI:23002 CHEBI:22504 CHEBI:3386 |
|
has_exact_synonym |
CARBAMIC ACID carbamic acid Carbamic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Carbamate Aminoameisensaeure Carbamidsaeure Aminoformic acid |
|
id |
CHEBI:28616 |
|
imported from | ||
in_subset | ||
inchi |
InChI=1S/CH3NO2/c2-1(3)4/h2H2,(H,3,4) |
|
inchikey |
KXDHJXZQYSOELW-UHFFFAOYSA-N |
|
is conjugate acid of | ||
label |
carbamic acid |
|
mass |
61.04006 |
|
monoisotopicmass |
61.01638 |
|
notation |
CHEBI:28616 |
|
prefLabel |
carbamic acid |
|
smiles |
NC(O)=O |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35352 |