loading...| Preferred Name |
carbamic acid |
|
| Synonyms |
CARBAMIC ACID carbamic acid Carbamic acid Carbamate Aminoameisensaeure Carbamidsaeure Aminoformic acid |
|
| Definitions |
A one-carbon compound that is ammonia in which one of the hydrogens is replaced by a carboxy group. Although carbamic acid derivatives are common, carbamic acid itself has never been synthesised. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28616 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:463-77-4 PDBeChem:OUT DrugBank:DB04261 Wikipedia:Carbamic_acid KEGG:C01563 Gmelin:130345 Beilstein:1734754 |
|
| definition |
A one-carbon compound that is ammonia in which one of the hydrogens is replaced by a carboxy group. Although carbamic acid derivatives are common, carbamic acid itself has never been synthesised. |
|
| formula |
CH3NO2 |
|
| has role | ||
| has_alternative_id |
CHEBI:44573 CHEBI:23002 CHEBI:22504 CHEBI:3386 |
|
| has_exact_synonym |
CARBAMIC ACID carbamic acid Carbamic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Carbamate Aminoameisensaeure Carbamidsaeure Aminoformic acid |
|
| id |
CHEBI:28616 |
|
| imported from | ||
| in_subset | ||
| inchi |
InChI=1S/CH3NO2/c2-1(3)4/h2H2,(H,3,4) |
|
| inchikey |
KXDHJXZQYSOELW-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| label |
carbamic acid |
|
| mass |
61.04006 |
|
| monoisotopicmass |
61.01638 |
|
| notation |
CHEBI:28616 |
|
| prefLabel |
carbamic acid |
|
| smiles |
NC(O)=O |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35352 |