Preferred Name | acetate | |
Synonyms |
CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M CH3-COO(-) Azetat MeCO2 anion acetic acid, ion(1-) ethanoate C2H3O2 59.04402 InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/p-1 ACETATE ION Ethanoat acetate |
|
Definitions |
A monocarboxylic acid anion resulting from the removal of a proton from the carboxy group of acetic acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_30089 |
|
database_cross_reference |
PDBeChem:ACT PMID:22371380 Gmelin:1379 MetaCyc:ACET CAS:71-50-1 KEGG:C00033 DrugBank:DB03166 Wikipedia:Acetate PMID:17190852 Reaxys:1901470 PMID:22211106 UM-BBD_compID:c0050 Beilstein:1901470 |
|
definition |
A monocarboxylic acid anion resulting from the removal of a proton from the carboxy group of acetic acid. |
|
has role | ||
has_alternative_id |
CHEBI:22165 CHEBI:13704 CHEBI:40480 |
|
has_exact_synonym |
acetate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M CH3-COO(-) Azetat MeCO2 anion acetic acid, ion(1-) ethanoate C2H3O2 59.04402 InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/p-1 ACETATE ION Ethanoat |
|
id |
CHEBI:30089 |
|
imported from | ||
is conjugate base of | ||
label |
acetate |
|
notation |
CHEBI:30089 |
|
prefLabel |
acetate |
|
subClassOf |