Preferred Name | acetate | |
Synonyms |
MeCO2 anion acetic acid, ion(1-) ACETATE ION Azetat CH3-COO(-) Ethanoat ethanoate acetate |
|
Definitions |
A monocarboxylic acid anion resulting from the removal of a proton from the carboxy group of acetic acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_30089 |
|
alternative label |
MeCO2 anion acetic acid, ion(1-) ACETATE ION Azetat CH3-COO(-) Ethanoat ethanoate acetate |
|
charge |
-1 |
|
database_cross_reference |
PMID:22371380 Gmelin:1379 CAS:71-50-1 PDBeChem:ACT Reaxys:1901470 KEGG:C00033 MetaCyc:ACET PMID:17190852 UM-BBD_compID:c0050 Wikipedia:Acetate Beilstein:1901470 DrugBank:DB03166 PMID:22211106 |
|
definition |
A monocarboxylic acid anion resulting from the removal of a proton from the carboxy group of acetic acid. |
|
formula |
C2H3O2 |
|
has role | ||
has_alternative_id |
CHEBI:13704 CHEBI:22165 CHEBI:40480 |
|
has_exact_synonym |
acetate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
MeCO2 anion acetic acid, ion(1-) ACETATE ION Azetat CH3-COO(-) Ethanoat ethanoate |
|
has_RxCUI |
164 |
|
id |
CHEBI:30089 |
|
in_subset | ||
inchi |
InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/p-1 |
|
inchikey |
QTBSBXVTEAMEQO-UHFFFAOYSA-M |
|
is conjugate base of | ||
label |
acetate |
|
mass |
59.04402 |
|
monoisotopicmass |
59.01385 |
|
notation |
CHEBI:30089 |
|
prefLabel |
acetate |
|
smiles |
CC([O-])=O |
|
subClassOf |