Preferred Name | acetate | |
Synonyms |
|
|
Definitions |
The conjugate base of acetic acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_30089 |
|
alternative term |
ethanoate CC([O-])=O C2H3O2 InChIKey=QTBSBXVTEAMEQO-UHFFFAOYSA-M Ethanoat Azetat acetate MeCO2 anion CH3-COO(-) acetic acid, ion(1-) InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/p-1 ACETATE ION |
|
definition |
The conjugate base of acetic acid. |
|
is conjugate base of | ||
label |
acetate |
|
prefixIRI |
CHEBI:30089 |
|
prefLabel |
acetate |
|
subClassOf |
Create mapping