Link to this page
Microbial Conditions Ontology
Last uploaded:
September 4, 2019
Jump to:
| Preferred Name | cysteine | |
| Synonyms |
InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6) C cisteina 121.020 2-amino-3-sulfanylpropanoic acid 121.15922 C3H7NO2S 2-Amino-3-mercaptopropionic acid Cys NC(CS)C(O)=O XUJNEKJLAYXESH-UHFFFAOYSA-N Zystein 2-amino-3-mercaptopropanoic acid 0 Hcys Cystein cysteine Cysteine |
|
| Definitions |
A sulfur-containing amino acid that is propanoic acid with an amino group at position 2 and a sulfanyl group at position 3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_15356 |
|
| database_cross_reference |
colombos:CYSTEINE colombos:CYSTEINE:+UNKNOWNg/L Wikipedia:Cysteine KEGG:C00736 CAS:3374-22-9 KNApSAcK:C00001351 Gmelin:2933 KNApSAcK:C00007323 PMID:17439666 Reaxys:1721406 Beilstein:1721406 PMID:25181601
|
|
| has exact synonym |
cysteine Cysteine
|
|
| has part | ||
| has role | ||
| has_alternative_id |
CHEBI:23508 CHEBI:4050 CHEBI:14061
|
|
| has_obo_namespace |
chebi_ontology
|
|
| has_related_synonym |
InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6) C cisteina 121.020 2-amino-3-sulfanylpropanoic acid 121.15922 C3H7NO2S 2-Amino-3-mercaptopropionic acid Cys NC(CS)C(O)=O XUJNEKJLAYXESH-UHFFFAOYSA-N Zystein 2-amino-3-mercaptopropanoic acid 0 Hcys Cystein
|
|
| id |
CHEBI:15356
|
|
| in_subset | ||
| is conjugate acid of | ||
| is conjugate base of | ||
| is tautomer of | ||
| label |
cysteine
|
|
| notation |
CHEBI:15356
|
|
| prefLabel |
cysteine
|
|
| textual definition |
A sulfur-containing amino acid that is propanoic acid with an amino group at position 2 and a sulfanyl group at position 3.
|
|
| subClassOf |
Add comment
| Delete | Subject | Author | Type | Created |
|---|---|---|---|---|
| No notes to display |
Create mapping