Link to this page
Human Interaction Network Ontology
Last uploaded:
June 27, 2014
Jump to:
| Preferred Name | cysteine | |
| Synonyms |
InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6) C cisteina 2-amino-3-sulfanylpropanoic acid C3H7NO2S 2-Amino-3-mercaptopropionic acid Cys NC(CS)C(O)=O InChIKey=XUJNEKJLAYXESH-UHFFFAOYSA-N Zystein 2-amino-3-mercaptopropanoic acid Hcys Cystein cysteine Cysteine |
|
| Definitions |
A sulfur-containing amino acid that is propanoic acid with an amino group at position 2 and a sulfanyl group at position 3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_15356 |
|
| database_cross_reference |
Wikipedia:Cysteine Gmelin:2933 ChemIDplus:3374-22-9 Reaxys:1721406 CiteXplore:17439666 NIST Chemistry WebBook:3374-22-9 Beilstein:1721406 KEGG COMPOUND:C00736
|
|
| definition |
A sulfur-containing amino acid that is propanoic acid with an amino group at position 2 and a sulfanyl group at position 3.
|
|
| has_alternative_id |
CHEBI:23508 CHEBI:4050 CHEBI:14061
|
|
| has_exact_synonym |
cysteine Cysteine
|
|
| has_obo_namespace |
chebi_ontology
|
|
| has_related_synonym |
InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6) C cisteina 2-amino-3-sulfanylpropanoic acid C3H7NO2S 2-Amino-3-mercaptopropionic acid Cys NC(CS)C(O)=O InChIKey=XUJNEKJLAYXESH-UHFFFAOYSA-N Zystein 2-amino-3-mercaptopropanoic acid Hcys Cystein
|
|
| id |
CHEBI:15356
|
|
| imported from | ||
| label |
cysteine
|
|
| notation |
CHEBI:15356
|
|
| prefLabel |
cysteine
|
|
| subClassOf |
Add comment
| Delete | Subject | Author | Type | Created |
|---|---|---|---|---|
| No notes to display |
Create mapping