loading...| Preferred Name | serotonin | |
| Synonyms |
5-Hydroxytryptamine thrombocytin 3-(2-Aminoethyl)-1H-indol-5-ol thrombotonin 5-HT Enteramine serotonine 3-(2-aminoethyl)-1H-indol-5-ol SEROTONIN Serotonin |
|
| Definitions |
A primary amino compound that is the 5-hydroxy derivative of tryptamine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28790 |
|
| bearer of |
http://purl.obolibrary.org/obo/CHEBI_25512 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:18593914 PMID:24136337 KEGG:C00780 Wikipedia:Serotonin MetaCyc:SEROTONIN LINCS:LSM-6589 Reaxys:143524 Beilstein:143524 CAS:50-67-9 PDBeChem:SRO Gmelin:1861995 PMID:22770225 HMDB:HMDB0000259 KNApSAcK:C00001429 |
|
| formula |
C10H12N2O |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_25512 |
|
| has_exact_synonym |
3-(2-aminoethyl)-1H-indol-5-ol SEROTONIN Serotonin |
|
| has_functional_parent | ||
| has_related_synonym |
5-Hydroxytryptamine thrombocytin 3-(2-Aminoethyl)-1H-indol-5-ol thrombotonin 5-HT Enteramine serotonine |
|
| hasAlternativeId |
CHEBI:26652 CHEBI:49894 CHEBI:1420 |
|
| hasOBONamespace |
chebi_ontology |
|
| id |
CHEBI:28790 |
|
| inchi |
InChI=1S/C10H12N2O/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h1-2,5-6,12-13H,3-4,11H2 |
|
| inchikey |
QZAYGJVTTNCVMB-UHFFFAOYSA-N |
|
| inSubset | ||
| is_conjugate_base_of | ||
| label |
serotonin |
|
| mass |
176.215 |
|
| monoisotopicmass |
176.09496 |
|
| notation |
CHEBI:28790 |
|
| prefLabel |
serotonin |
|
| smiles |
C1=CC(=CC=2C(=CNC12)CCN)O |
|
| textual definition |
A primary amino compound that is the 5-hydroxy derivative of tryptamine. |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_27162 http://purl.obolibrary.org/obo/CHEBI_33853 http://purl.obolibrary.org/obo/CHEBI_84729 |