loading...| Preferred Name | CHEBI_15366 | |
| Synonyms |
Ethylic acid Ethanoic acid Methanecarboxylic acid Essigsaeure acide acetique ethoic acid INS No. 260 AcOH CH3-COOH CH3CO2H E 260 E-260 E260 HOAc MeCO2H MeCOOH ACETIC ACID acetic acid Acetic acid |
|
| Definitions |
A simple monocarboxylic acid containing two carbons. LanguaL term definition: Food additive; technological purpose(s): acidity regulator, preservative. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_15366 |
|
| comment |
LanguaL term definition: Food additive; technological purpose(s): acidity regulator, preservative. |
|
| bearer of |
http://purl.obolibrary.org/obo/CHEBI_83056 http://purl.obolibrary.org/obo/CHEBI_64049 |
|
| charge |
0 |
|
| formula |
C2H4O2 |
|
| has exact synonym |
ACETIC ACID acetic acid Acetic acid |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_83056 http://purl.obolibrary.org/obo/CHEBI_64049 |
|
| hasAlternativeId |
CHEBI:22169 CHEBI:40486 CHEBI:2387 |
|
| hasOBONamespace |
chebi_ontology |
|
| hasRelatedSynonym |
Ethylic acid Ethanoic acid Methanecarboxylic acid Essigsaeure acide acetique ethoic acid INS No. 260 AcOH CH3-COOH CH3CO2H E 260 E-260 E260 HOAc MeCO2H MeCOOH |
|
| hasSynonym |
acetic acid, glacial |
|
| IAO_0000118 |
acetic acid |
|
| IAO_0000412 |
http://purl.obolibrary.org/obo/chebi.owl |
|
| id |
CHEBI:15366 |
|
| inchi |
InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4) |
|
| inchikey |
QTBSBXVTEAMEQO-UHFFFAOYSA-N |
|
| inSubset | ||
| is conjugate acid of | ||
| label |
acetic acid acetic acid |
|
| mass |
60.05200 |
|
| monoisotopicmass |
60.02113 |
|
| notation |
CHEBI:15366 |
|
| prefLabel |
CHEBI_15366 |
|
| smiles |
CC(O)=O |
|
| textual definition |
A simple monocarboxylic acid containing two carbons. |
|
| xRef |
Wikipedia:Acetic_acid PMID:19416101 PMID:22153255 PMID:12005138 PDBeChem:ACY PMID:19469536 CAS:64-19-7 PDBeChem:ACT Drug_Central:4211 LIPID_MAPS_instance:LMFA01010002 PMID:15107950 KEGG:C00033 MetaCyc:ACET Gmelin:1380 PMID:17190852 Reaxys:506007 KNApSAcK:C00001176 PMID:22173419 Beilstein:506007 PMID:16774200 KEGG:D00010 Europe::260 PMID:16630552 HMDB:HMDB0000042 http://www.langual.org/langual_thesaurus.asp?termid=B2977 Codex::260 PPDB:1333 |
|
| subClassOf |