Jump to:
loading...| Preferred Name | L-phenylalanine | |
| Synonyms |
|
|
| Definitions |
The L-enantiomer of phenylalanine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17295 |
|
| alternative term |
C9H11NO2 L-phenylalanine L-Phenylalanine beta-phenyl-L-alanine 3-phenyl-L-alanine Phe (2S)-2-amino-3-phenylpropanoic acid (S)-alpha-Amino-beta-phenylpropionic acid InChIKey=COLNVLDHVKWLRT-QMMMGPOBSA-N InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1 F PHENYLALANINE N[C@@H](Cc1ccccc1)C(O)=O |
|
| definition |
The L-enantiomer of phenylalanine. |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| is enantiomer of | ||
| is tautomer of | ||
| label |
L-phenylalanine |
|
| prefixIRI |
CHEBI:17295 |
|
| prefLabel |
L-phenylalanine |
|
| subClassOf |
Create mapping