Preferred Name | phenylalanine | |
Synonyms |
|
|
Definitions |
An aromatic amino acid that has formula C9H11NO2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_28044 |
|
alternative term |
InChIKey=COLNVLDHVKWLRT-UHFFFAOYSA-N C9H11NO2 InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12) Phenylalanine alpha-Amino-beta-phenylpropionic acid NC(Cc1ccccc1)C(O)=O fenilalanina phenylalanine Phenylalanin 2-amino-3-phenylpropanoic acid |
|
definition |
An aromatic amino acid that has formula C9H11NO2. |
|
has part | ||
is conjugate acid of | ||
is conjugate base of | ||
label |
phenylalanine |
|
prefixIRI |
CHEBI:28044 |
|
prefLabel |
phenylalanine |
|
subClassOf |
Create mapping