Preferred Name |
colchicine |
|
Synonyms |
N-(1,2,3,10-tetramethoxy-9-oxo-5,6,7,9-tetrahydrobenzo[a]heptalen-7-yl)acetamide |
|
Definitions |
An alkaloid that is a carbotricyclic compound comprising 5,6,7,9-tetrahydrobenzo[a]heptalene having four methoxy substituents at the 1-, 2-, 3- and 10-positions as well as an oxo group at the 9-position and an acetamido group at the 7-position. It has been isolated from the plants belonging to genus Colchicum. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_23359 |
|
charge |
0 |
|
database_cross_reference |
PMID:24074178 HMDB:HMDB0015466 PMID:9819133 CAS:54192-66-4 Beilstein:2228812 LINCS:LSM-6449 PMID:10680067 PMID:7200520 Reaxys:2228812 DrugBank:DB01394 |
|
formula |
C22H25NO6 |
|
has role | ||
has_exact_synonym |
N-(1,2,3,10-tetramethoxy-9-oxo-5,6,7,9-tetrahydrobenzo[a]heptalen-7-yl)acetamide |
|
has_obo_namespace |
chebi_ontology |
|
has_RxCUI |
2683 |
|
id |
CHEBI:23359 |
|
in_subset | ||
inchi |
InChI=1S/C22H25NO6/c1-12(24)23-16-8-6-13-10-19(27-3)21(28-4)22(29-5)20(13)14-7-9-18(26-2)17(25)11-15(14)16/h7,9-11,16H,6,8H2,1-5H3,(H,23,24) |
|
inchikey |
IAKHMKGGTNLKSZ-UHFFFAOYSA-N |
|
label |
colchicine Colchicine |
|
mass |
399.43704 |
|
monoisotopicmass |
399.16819 |
|
notation |
CHEBI:23359 |
|
prefixIRI |
CHEBI:23359 |
|
prefLabel |
colchicine |
|
smiles |
COc1cc2CCC(NC(C)=O)c3cc(=O)c(OC)ccc3-c2c(OC)c1OC |
|
textual definition |
An alkaloid that is a carbotricyclic compound comprising 5,6,7,9-tetrahydrobenzo[a]heptalene having four methoxy substituents at the 1-, 2-, 3- and 10-positions as well as an oxo group at the 9-position and an acetamido group at the 7-position. It has been isolated from the plants belonging to genus Colchicum. |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_38032 http://purl.obolibrary.org/obo/CHEBI_22315 |