Preferred Name |
proline |
|
Synonyms |
proline pyrrolidine-2-carboxylic acid OC(=O)C1CCCN1 prolina InChI=1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8) Prolin 115.13050 Hpro ONIBWKKTOPOVIA-UHFFFAOYSA-N DL-Proline C5H9NO2 |
|
Definitions |
An alpha-amino acid that is pyrrolidine bearing a carboxy substituent at position 2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_26271 |
|
database_cross_reference |
PMID:16534801 Wikipedia:Proline PMID:22770225 KEGG:C16435 PMID:22264337 PMID:21903295 CAS:609-36-9 Gmelin:26927 PMID:22280966 Beilstein:80809 Reaxys:80809 PMID:21400017 |
|
definition |
An alpha-amino acid that is pyrrolidine bearing a carboxy substituent at position 2. |
|
has role | ||
has_exact_synonym |
proline |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
pyrrolidine-2-carboxylic acid OC(=O)C1CCCN1 prolina InChI=1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8) Prolin 115.13050 Hpro ONIBWKKTOPOVIA-UHFFFAOYSA-N DL-Proline C5H9NO2 |
|
id |
CHEBI:26271 |
|
imported from | ||
is conjugate acid of | ||
is conjugate base of | ||
label |
proline |
|
notation |
CHEBI:26271 |
|
prefLabel |
proline |
|
subClassOf |