Preferred Name |
cisplatin |
|
Synonyms |
|
|
Definitions |
A diamminedichloroplatinum compound in which the two ammine ligands and two chloro ligands are oriented in a cis planar configuration around the central platinum ion. An anticancer drug that interacts with, and forms cross-links between, DNA and proteins, it is used as a neoplasm inhibitor to treat solid tumours, primarily of the testis and ovary. Commonly but incorrectly described as an alkylating agent due to its mechanism of action (but it lacks alkyl groups). |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_27899 |
|
charge |
0 |
|
definition |
A diamminedichloroplatinum compound in which the two ammine ligands and two chloro ligands are oriented in a cis planar configuration around the central platinum ion. An anticancer drug that interacts with, and forms cross-links between, DNA and proteins, it is used as a neoplasm inhibitor to treat solid tumours, primarily of the testis and ovary. Commonly but incorrectly described as an alkylating agent due to its mechanism of action (but it lacks alkyl groups). |
|
formula |
Cl2H6N2Pt H6Cl2N2Pt |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_47868 http://purl.obolibrary.org/obo/CHEBI_35610 http://purl.obolibrary.org/obo/CHEBI_50684 http://purl.obolibrary.org/obo/CHEBI_25435 http://purl.obolibrary.org/obo/CHEBI_173085 |
|
inchi |
InChI=1S/2ClH.2H3N.Pt/h2*1H;2*1H3;/q;;;;+2/p-2 |
|
inchikey |
LXZZYRPGZAFOLE-UHFFFAOYSA-L |
|
label |
cisplatin |
|
mass |
300.04452 |
|
monoisotopicmass |
298.95560 |
|
prefixIRI |
CHEBI:27899 |
|
prefLabel |
cisplatin |
|
smiles |
[H][N]([H])([H])[Pt](Cl)(Cl)[N]([H])([H])[H] |
|
subClassOf |