loading...| Preferred Name |
phenobarbital |
|
| Synonyms |
5-ethyl-5-phenylpyrimidine-2,4,6(1H,3H,5H)-trione Phenobarbital Phenylethylbarbitursaeure Phenobarbitone phenobarbital Phenobarbituric Acid Phenobarbitol 5-Ethyl-5-phenyl-pyrimidine-2,4,6-trione Phenylethylbarbiturate 5-ethyl-5-phenyl-2,4,6(1H,3H,5H)-pyrimidinetrione Luminal Phenylethylmalonylurea Phenylethylbarbituric Acid PHENYLETHYLMALONYLUREA 5-Ethyl-5-phenylbarbituric acid 5-Phenyl-5-ethylbarbituric acid Phenylaethylbarbitursaeure Epilol Bardorm Etilfen Hypnoltol Duneryl Barbinal Cabronal Barbivis Blu-Phen Hypnolone Aphenylbarbit Cratecil Hypno-Tablinetten Aephenal Barbiphen Coronaletta Barbonal Haplopan Calmetten Dezibarbitur Dormina Glysoletten Epsylone Dormital Helional Hypnogen Barbenyl Fenbital Epanal Hypnaletten Hypnette Barbipil Epidorm Chinoin Doscalun Hennoletten Fenylettae Dormiral Barbophen Agrypnal Euneryl Eskabarb Ensodorm Gardepanyl Fenosed Calminal Gardenal Adonal Fenobarbital Henotal Barbita Barbiphenyl Codibarbita Episedal Haplos Ensobarb Amylofene Damoral Bartol Aphenyletten Fenemal Cardenal Bialminal |
|
| Definitions |
A barbituric acid derivative that acts as a nonselective central nervous system depressant. It promotes binding to inhibitory gamma-aminobutyric acid subtype receptors, and modulates chloride currents through receptor channels. It also inhibits glutamate induced depolarizations. (PubChem) Pharmacology: Phenobarbital, the longest-acting barbiturate, is used for its anticonvulsant and sedative-hypnotic properties in the management of all seizure disorders except absence (petit mal). Mechanism of action: Phenobarbital acts on GABAA receptors, increasing synaptic inhibition. This has the effect of elevating seizure threshold and reducing the spread of seizure activity from a seizure focus. Phenobarbital may also inhibit calcium channels, resulting in a decrease in excitatory transmitter release. The sedative-hypnotic effects of phenobarbital are likely the result of its effect on the polysynaptic midbrain reticular formation, which controls CNS arousal. Drug type: Approved. Small Molecule. Drug category: Anticonvulsants. Excitatory Amino Acid Antagonists. GABA Modulators. Hypnotics and Sedatives A member of the class of barbiturates, the structure of which is that of barbituric acid substituted at C-5 by ethyl and phenyl groups. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8069 |
|
| charge |
0 |
|
| createdDate |
March 5, 2010 |
|
| database_cross_reference |
PMID:10891117 PMID:2579237 PMID:17481896 PMID:8230125 PMID:2724304 PMID:8691481 PMID:12873507 Beilstein:233363 PMID:6716399 PMID:2308141 PMID:8035421 Patent:US1025872 PMID:12361404 PMID:3572984 Gmelin:336231 PMID:7381857 PMID:3336019 PMID:6737420 PMID:3783589 PMID:17300161 PMID:3950916 PMID:3016269 PMID:15324906 CAS:50-06-6 PMID:3820228 PMID:11311072 PMID:8246220 PMID:4032429 PMID:1875341 PMID:3654008 PMID:3950919 Drug_Central:2134 PMID:9016327 PMID:3783590 PMID:9544213 PMID:15857133 KEGG:D00506 PMID:7562939 PMID:1495012 HMDB:HMDB0015305 PMID:16789751 PMID:1992141 PMID:17870541 PMID:2170646 PMID:7205879 PMID:1681105 PMID:2296016 PMID:16793262 PMID:8627613 DrugBank:DB01174 PMID:17827020 Reaxys:233363 Wikipedia:Phenobarbital PMID:3735320 KEGG:C07434 PMID:2061925 PMID:7799408 PMID:3599019 PMID:16190747 PMID:6864729 PMID:16139502 PMID:2308142 PMID:10866370 |
|
| definition |
A barbituric acid derivative that acts as a nonselective central nervous system depressant. It promotes binding to inhibitory gamma-aminobutyric acid subtype receptors, and modulates chloride currents through receptor channels. It also inhibits glutamate induced depolarizations. (PubChem) Pharmacology: Phenobarbital, the longest-acting barbiturate, is used for its anticonvulsant and sedative-hypnotic properties in the management of all seizure disorders except absence (petit mal). Mechanism of action: Phenobarbital acts on GABAA receptors, increasing synaptic inhibition. This has the effect of elevating seizure threshold and reducing the spread of seizure activity from a seizure focus. Phenobarbital may also inhibit calcium channels, resulting in a decrease in excitatory transmitter release. The sedative-hypnotic effects of phenobarbital are likely the result of its effect on the polysynaptic midbrain reticular formation, which controls CNS arousal. Drug type: Approved. Small Molecule. Drug category: Anticonvulsants. Excitatory Amino Acid Antagonists. GABA Modulators. Hypnotics and Sedatives |
|
| formula |
C12H12N2O3 |
|
| has characteristic | ||
| has exact synonym |
5-ethyl-5-phenylpyrimidine-2,4,6(1H,3H,5H)-trione Phenobarbital |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_60798 http://purl.obolibrary.org/obo/CHEBI_35717 |
|
| has_alternative_id |
CHEBI:102217 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Phenylethylbarbitursaeure Phenobarbitone phenobarbital Phenobarbituric Acid Phenobarbitol 5-Ethyl-5-phenyl-pyrimidine-2,4,6-trione Phenylethylbarbiturate 5-ethyl-5-phenyl-2,4,6(1H,3H,5H)-pyrimidinetrione Luminal 5-ethyl-5-phenylpyrimidine-2,4,6(1H,3H,5H)-trione Phenylethylmalonylurea Phenylethylbarbituric Acid PHENYLETHYLMALONYLUREA 5-Ethyl-5-phenylbarbituric acid 5-Phenyl-5-ethylbarbituric acid Phenylaethylbarbitursaeure |
|
| hasExternalSource |
DB01174 |
|
| id |
CHEBI:8069 |
|
| in_subset | ||
| inchi |
InChI=1S/C12H12N2O3/c1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16/h3-7H,2H2,1H3,(H2,13,14,15,16,17) |
|
| inchikey |
DDBREPKUVSBGFI-UHFFFAOYSA-N |
|
| label |
phenobarbital |
|
| mass |
232.23530 |
|
| modifiedDate |
April 15, 2010 |
|
| monoisotopicmass |
232.08479 |
|
| notation |
CHEBI:8069 |
|
| prefixIRI |
CHEBI:8069 |
|
| prefLabel |
phenobarbital |
|
| smiles |
CCC1(C(=O)NC(=O)NC1=O)c1ccccc1 |
|
| synonym |
Epilol Bardorm Etilfen Hypnoltol Duneryl Barbinal Cabronal Barbivis Blu-Phen Hypnolone Aphenylbarbit Cratecil Hypno-Tablinetten Aephenal Barbiphen Coronaletta Barbonal Haplopan Calmetten Dezibarbitur Dormina Glysoletten Epsylone Dormital Helional Hypnogen Barbenyl Fenbital Epanal Hypnaletten Hypnette Barbipil Epidorm Chinoin Doscalun Hennoletten Fenylettae Dormiral Barbophen Agrypnal Euneryl Eskabarb Ensodorm Gardepanyl Fenosed Calminal Gardenal Adonal Fenobarbital Henotal Barbita Barbiphenyl Codibarbita Episedal Haplos Ensobarb Amylofene Damoral Bartol Aphenyletten Fenemal Cardenal Bialminal |
|
| subClassOf |