Preferred Name |
amiodarone |
|
Synonyms |
Amiodarone (2-butyl-1-benzofuran-3-yl){4-[2-(diethylamino)ethoxy]-3,5-diiodophenyl}methanone 2-Butyl-3-benzofuranyl 4-(2-(diethylamino)ethoxy)-3,5-diiodophenyl ketone 2-Butyl-3-(3,5-diiodo-4-(2-diethylaminoethoxy)benzoyl)benzofuran amiodarona 2-n-Butyl-3',5'-diiodo-4'-N-diethylaminoethoxy-3-benzoylbenzofuran amiodaronum |
|
Definitions |
A member of the class of 1-benzofurans that is 1-benzofuran substituted by a butyl group at position 2 and a 4-[2-(diethylamino)ethoxy]-3,5-diiodobenzoyl group at position 3. It is a cardiovascular drug used for the treatment of cardiac dysrhythmias. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_2663 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Amiodarone KEGG:D02910 PMID:16479044 Patent:TW201400111 HMDB:HMDB0015250 PMID:10188629 LINCS:LSM-2379 Beilstein:1271711 Patent:CA2826272 DrugBank:DB01118 CAS:1951-25-3 PMID:18368867 KEGG:C06823 Drug_Central:176 |
|
definition |
A member of the class of 1-benzofurans that is 1-benzofuran substituted by a butyl group at position 2 and a 4-[2-(diethylamino)ethoxy]-3,5-diiodobenzoyl group at position 3. It is a cardiovascular drug used for the treatment of cardiac dysrhythmias. |
|
formula |
C25H29I2NO3 |
|
has exact synonym |
Amiodarone (2-butyl-1-benzofuran-3-yl){4-[2-(diethylamino)ethoxy]-3,5-diiodophenyl}methanone |
|
has role | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2-Butyl-3-benzofuranyl 4-(2-(diethylamino)ethoxy)-3,5-diiodophenyl ketone 2-Butyl-3-(3,5-diiodo-4-(2-diethylaminoethoxy)benzoyl)benzofuran amiodarona 2-n-Butyl-3',5'-diiodo-4'-N-diethylaminoethoxy-3-benzoylbenzofuran amiodaronum |
|
id |
CHEBI:2663 |
|
in_subset | ||
inchi |
InChI=1S/C25H29I2NO3/c1-4-7-11-22-23(18-10-8-9-12-21(18)31-22)24(29)17-15-19(26)25(20(27)16-17)30-14-13-28(5-2)6-3/h8-10,12,15-16H,4-7,11,13-14H2,1-3H3 |
|
inchikey |
IYIKLHRQXLHMJQ-UHFFFAOYSA-N |
|
label |
amiodarone |
|
mass |
645.31160 |
|
monoisotopicmass |
645.02368 |
|
notation |
CHEBI:2663 |
|
prefLabel |
amiodarone |
|
smiles |
CCCCc1oc2ccccc2c1C(=O)c1cc(I)c(OCCN(CC)CC)c(I)c1 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_38830 http://purl.obolibrary.org/obo/CHEBI_76224 |