Fission Yeast Phenotype Ontology

Last uploaded: May 14, 2019
Preferred Name

amphotericin B

Synonyms

APKFDSVGJQXUKY-INPOYWNPSA-N

C47H73NO17

Amphotericine B

AMPH-B

amfotericina B

924.07900

InChI=1S/C47H73NO17/c1-27-17-15-13-11-9-7-5-6-8-10-12-14-16-18-34(64-46-44(58)41(48)43(57)30(4)63-46)24-38-40(45(59)60)37(54)26-47(61,65-38)25-33(51)22-36(53)35(52)20-19-31(49)21-32(50)23-39(55)62-29(3)28(2)42(27)56/h5-18,27-38,40-44,46,49-54,56-58,61H,19-26,48H2,1-4H3,(H,59,60)/b6-5+,9-7+,10-8+,13-11+,14-12+,17-15+,18-16+/t27-,28-,29-,30+,31+,32+,33-,34-,35+,36+,37-,38-,40+,41-,42+,43+,44-,46-,47+/m0/s1

amphotericine B

amphotericinum B

(1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19E,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-33-[(3-amino-3,6-dideoxy-beta-D-mannopyranosyl)oxy]-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid

amphotericin B

[H][C@]12C[C@@H](O[C@@H]3O[C@H](C)[C@@H](O)[C@H](N)[C@@H]3O)C=C\C=C\C=C\C=C\C=C\C=C\C=C\[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC(=O)C[C@H](O)C[C@H](O)CC[C@@H](O)[C@H](O)C[C@H](O)C[C@](O)(C[C@H](O)[C@H]1C(O)=O)O2

Liposomal Amphotericin B

Definitions

A macrolide antibiotic used to treat potentially life-threatening fungal infections.

ID

http://purl.obolibrary.org/obo/CHEBI_2682

database_cross_reference

KEGG:C06573

Beilstein:4645978

Patent:US2908611

Reaxys:4645978

CAS:1397-89-3

PMID:16120633

PMID:11429202

KEGG:D00203

Wikipedia:Amphotericin_B

PMID:17507115

DrugBank:DB00681

PMID:16793999

LIPID_MAPS_instance:LMPK06000002

PMID:1732516

definition

A macrolide antibiotic used to treat potentially life-threatening fungal infections.

has_alternative_id

CHEBI:566395

CHEBI:106303

has_exact_synonym

(1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19E,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-33-[(3-amino-3,6-dideoxy-beta-D-mannopyranosyl)oxy]-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid

has_obo_namespace

chebi_ontology

has_related_synonym

APKFDSVGJQXUKY-INPOYWNPSA-N

C47H73NO17

Amphotericine B

AMPH-B

amfotericina B

924.07900

InChI=1S/C47H73NO17/c1-27-17-15-13-11-9-7-5-6-8-10-12-14-16-18-34(64-46-44(58)41(48)43(57)30(4)63-46)24-38-40(45(59)60)37(54)26-47(61,65-38)25-33(51)22-36(53)35(52)20-19-31(49)21-32(50)23-39(55)62-29(3)28(2)42(27)56/h5-18,27-38,40-44,46,49-54,56-58,61H,19-26,48H2,1-4H3,(H,59,60)/b6-5+,9-7+,10-8+,13-11+,14-12+,17-15+,18-16+/t27-,28-,29-,30+,31+,32+,33-,34-,35+,36+,37-,38-,40+,41-,42+,43+,44-,46-,47+/m0/s1

amphotericine B

amphotericinum B

amphotericin B

[H][C@]12C[C@@H](O[C@@H]3O[C@H](C)[C@@H](O)[C@H](N)[C@@H]3O)C=C\C=C\C=C\C=C\C=C\C=C\C=C\[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC(=O)C[C@H](O)C[C@H](O)CC[C@@H](O)[C@H](O)C[C@H](O)C[C@](O)(C[C@H](O)[C@H]1C(O)=O)O2

Liposomal Amphotericin B

IAO_0000412

http://purl.obolibrary.org/obo/chebi.owl

id

CHEBI:2682

label

amphotericin B

notation

CHEBI:2682

prefLabel

amphotericin B

subClassOf

http://purl.obolibrary.org/obo/CHEBI_25105

http://purl.obolibrary.org/obo/CHEBI_26177

http://purl.obolibrary.org/obo/CHEBI_87113

Delete Subject Author Type Created
No notes to display
Create New Mapping

Delete Mapping To Ontology Source
http://stirdf.jst.go.jp/id/200907033675065913 IOBC LOOM
http://purl.bioontology.org/ontology/UATC/A07AA07 ATC LOOM
http://purl.bioontology.org/ontology/UATC/G01AA03 ATC LOOM
http://purl.obolibrary.org/obo/DDO.owl#DDO_0005038 DDO LOOM
http://purl.obolibrary.org/obo/DDO.owl#DDO_0005038 DMTO LOOM
http://purl.bioontology.org/ontology/NDFRT/N0000145996 NDFRT LOOM
http://purl.bioontology.org/ontology/SNMI/C-52B20 SNMI LOOM
http://purl.bioontology.org/ontology/LNC/MTHU006779 LOINC LOOM
http://purl.bioontology.org/ontology/SNOMEDCT/77703004 SNOMEDCT LOOM
http://purl.bioontology.org/ontology/RXNORM/732 RXNORM LOOM
http://purl.jp/bio/4/id/200906088655935976 IOBC LOOM
http://phenomebrowser.net/ontologies/mesh/mesh.owl#D000666 RH-MESH LOOM
http://phenomebrowser.net/ontologies/mesh/mesh.owl#D02.540.505.050 RH-MESH LOOM
http://purl.bioontology.org/ontology/LNC/LP15581-9 LOINC LOOM
http://purl.obolibrary.org/obo/CHEBI_2682 BIOMODELS LOOM
http://purl.obolibrary.org/obo/CHEBI_2682 BIOMODELS SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 CHEBI LOOM
http://purl.obolibrary.org/obo/CHEBI_2682 CHEBI SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 CCONT LOOM
http://purl.obolibrary.org/obo/CHEBI_2682 CCONT SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 DINTO LOOM
http://purl.obolibrary.org/obo/CHEBI_2682 DINTO SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 EFO LOOM
http://purl.obolibrary.org/obo/CHEBI_2682 EFO SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 DRON SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 EUPATH LOOM
http://purl.obolibrary.org/obo/CHEBI_2682 EUPATH SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 CHEBI LOOM
http://purl.obolibrary.org/obo/CHEBI_2682 CHEBI SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 EFO LOOM
http://purl.obolibrary.org/obo/CHEBI_2682 EFO SAME_URI
http://purl.bioontology.org/ontology/MESH/D000666 MESH LOOM
http://purl.bioontology.org/ontology/UATC/A01AB04 ATC LOOM
http://purl.bioontology.org/ontology/UATC/J02AA01 ATC LOOM
http://bmi.utah.edu/ontologies/hfontology/C0002679 HFO LOOM
http://purl.bioontology.org/ontology/CSP/0191-9825 CRISP LOOM
http://purl.bioontology.org/ontology/NDDF/002887 NDDF LOOM
http://ncicb.nci.nih.gov/xml/owl/EVS/Thesaurus.owl#C238 NCIT LOOM
http://ncicb.nci.nih.gov/xml/owl/EVS/Thesaurus.owl#C238 NCIT LOOM
http://purl.bioontology.org/ontology/VANDF/4017616 VANDF LOOM
http://d-nb.info/gnd/4281236-7 FAST-TOPICAL LOOM