loading...| Preferred Name |
Dopamine |
|
| Synonyms |
4-(2-aminoethyl)benzene-1,2-diol Dopamine a-(3,4-Dihydroxyphenyl)-b-aminoethane Hydroxytyramin 3,4-Dihydroxyphenylethylamine 2-(3,4-Dihydroxyphenyl)ethylamine Revivan Deoxyepinephrine C8H11NO2 NCCc1ccc(O)c(O)c1 4-(2-aminoethyl)catechol dopamine 3,4-Dihydroxyphenethylamine Dopaminum dopaminum 4-(2-azanylethyl)benzene-1,2-diol 4-(2-Aminoethyl)-Pyrocatechol Hydroxytyramine alpha-(3,4-Dihydroxyphenyl)-beta-aminoethane 4-(2-Aminoethyl)-1,2-benzenediol Dynatra Dopamin 4-(2-aminoethyl)pyrocatechol VYFYYTLLBUKUHU-UHFFFAOYSA-N 4-(2-Aminoethyl)benzene-1,2-diol 3-Hydroxytyramine L-DOPAMINE Dopastat dopamina Oxytyramine 4-(2-aminoethyl)-1,2-benzenediol InChI=1S/C8H11NO2/c9-4-3-6-1-2-7(10)8(11)5-6/h1-2,5,10-11H,3-4,9H2 2-(3,4-dihydroxyphenyl)ethylamine Intropin Dophamine |
|
| Definitions |
Catechol in which the hydrogen at position 4 is substituted by a 2-aminoethyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_18243 |
|
| database_cross_reference |
CiteXplore:16757377 CiteXplore:7059264 HMDB:HMDB00073 CiteXplore:6085021 ChemIDplus:51-61-6 CiteXplore:9360553 CiteXplore:16412483 CiteXplore:14561867 KEGG COMPOUND:C03758 CiteXplore:11477488 CiteXplore:16818870 CiteXplore:10494443 MetaCyc:DOPAMINE CiteXplore:16146016 CiteXplore:10489384 CiteXplore:8884658 CiteXplore:12649306 CiteXplore:11805404 Wikipedia:Dopamine CiteXplore:9849813 CiteXplore:12622787 KNApSAcK:C00001408 PDBeChem:LDP CiteXplore:16601073 CiteXplore:7161364 CiteXplore:16806124 CiteXplore:16449954 CiteXplore:12834252 CiteXplore:17237217 CiteXplore:11149432 CiteXplore:16317894 CiteXplore:17031479 CiteXplore:15080725 CiteXplore:9858756 KEGG DRUG:D07870 CiteXplore:10629745 Reaxys:1072822 CiteXplore:9422813 DrugBank:DB00988 KEGG COMPOUND:62-31-7 CiteXplore:20669995 |
|
| definition |
Catechol in which the hydrogen at position 4 is substituted by a 2-aminoethyl group. |
|
| has_alternative_id |
CHEBI:14203 CHEBI:23886 CHEBI:1764 CHEBI:11695 CHEBI:11930 CHEBI:43686 |
|
| has_exact_synonym |
4-(2-aminoethyl)benzene-1,2-diol Dopamine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
a-(3,4-Dihydroxyphenyl)-b-aminoethane Hydroxytyramin 3,4-Dihydroxyphenylethylamine 2-(3,4-Dihydroxyphenyl)ethylamine Revivan Deoxyepinephrine C8H11NO2 NCCc1ccc(O)c(O)c1 4-(2-aminoethyl)catechol dopamine 3,4-Dihydroxyphenethylamine Dopaminum dopaminum 4-(2-azanylethyl)benzene-1,2-diol 4-(2-Aminoethyl)-Pyrocatechol Hydroxytyramine alpha-(3,4-Dihydroxyphenyl)-beta-aminoethane 4-(2-Aminoethyl)-1,2-benzenediol Dynatra Dopamin 4-(2-aminoethyl)pyrocatechol VYFYYTLLBUKUHU-UHFFFAOYSA-N 4-(2-Aminoethyl)benzene-1,2-diol 3-Hydroxytyramine L-DOPAMINE Dopastat dopamina Oxytyramine 4-(2-aminoethyl)-1,2-benzenediol InChI=1S/C8H11NO2/c9-4-3-6-1-2-7(10)8(11)5-6/h1-2,5,10-11H,3-4,9H2 2-(3,4-dihydroxyphenyl)ethylamine Intropin Dophamine |
|
| id |
CHEBI:18243 |
|
| imported from | ||
| label |
dopamine Dopamine |
|
| notation |
CHEBI:18243 |
|
| prefixIRI |
CHEBI:18243 |
|
| prefLabel |
Dopamine |
|
| subClassOf |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.