loading...| Preferred Name |
lycopene |
|
| Synonyms |
psi,psi-carotene LYCOPENE Lycopene (6E,8E,10E,12E,14E,16E,18E,20E,22E,24E,26E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,8,10,12,14,16,18,20,22,24,26,30-tridecaene all-trans-lycopene |
|
| Definitions |
An acyclic carotene commonly obtained from tomatoes and other red fruits. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_15948 |
|
| charge |
0 |
|
| database_cross_reference |
LIPID_MAPS_instance:LMPR01070257 MetaCyc:CPD1F-114 PMID:16194683 PDBeChem:LYC PMID:12792623 PMID:15830922 PMID:1550343 PMID:15065899 PMID:24397737 KEGG:C05432 HMDB:HMDB0003000 PMID:12910307 Reaxys:1730097 PMID:12726756 PMID:10620348 PMID:15341191 Beilstein:1730097 PMID:12239422 PMID:13129444 PMID:10493308 PMID:7616301 Drug_Central:4617 PMID:10443333 CAS:502-65-8 Wikipedia:Lycopene PMID:10720168 COMe:MOL000048 PMID:11117277 PMID:11137891 KNApSAcK:C00000911 PMID:16549453 PMID:10837319 PMID:15054415 PMID:9100211 |
|
| definition |
An acyclic carotene commonly obtained from tomatoes and other red fruits. |
|
| formula |
C40H56 |
|
| has part | ||
| has role | ||
| has_alternative_id |
CHEBI:14541 CHEBI:26367 CHEBI:43789 CHEBI:6596 |
|
| has_exact_synonym |
psi,psi-carotene LYCOPENE Lycopene |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(6E,8E,10E,12E,14E,16E,18E,20E,22E,24E,26E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,8,10,12,14,16,18,20,22,24,26,30-tridecaene all-trans-lycopene |
|
| has_RxCUI |
29008 |
|
| id |
CHEBI:15948 |
|
| in_subset | ||
| inchi |
InChI=1S/C40H56/c1-33(2)19-13-23-37(7)27-17-31-39(9)29-15-25-35(5)21-11-12-22-36(6)26-16-30-40(10)32-18-28-38(8)24-14-20-34(3)4/h11-12,15-22,25-32H,13-14,23-24H2,1-10H3/b12-11+,25-15+,26-16+,31-17+,32-18+,35-21+,36-22+,37-27+,38-28+,39-29+,40-30+ |
|
| inchikey |
OAIJSZIZWZSQBC-GYZMGTAESA-N |
|
| label |
lycopene |
|
| mass |
536.87264 |
|
| monoisotopicmass |
536.43820 |
|
| notation |
CHEBI:15948 |
|
| prefLabel |
lycopene |
|
| smiles |
CC(C)=CCC\C(C)=C\C=C\C(C)=C\C=C\C(C)=C\C=C\C=C(C)\C=C\C=C(C)\C=C\C=C(/C)CCC=C(C)C |
|
| subClassOf |