loading...| Preferred Name |
Phenobarbital |
|
| Synonyms |
Phenobarbital 5-ethyl-5-phenylpyrimidine-2,4,6(1H,3H,5H)-trione Phenylethylmalonylurea Phenobarbitone PHENYLETHYLMALONYLUREA Phenylethylbarbiturate Phenobarbituric Acid 5-Phenyl-5-ethylbarbituric acid phenobarbital Phenylethylbarbitursaeure 5-Ethyl-5-phenylbarbituric acid 5-Ethyl-5-phenyl-pyrimidine-2,4,6-trione Phenobarbitol Phenylaethylbarbitursaeure 5-ethyl-5-phenyl-2,4,6(1H,3H,5H)-pyrimidinetrione Phenylethylbarbituric Acid Luminal |
|
| Definitions |
A member of the class of barbiturates, the structure of which is that of barbituric acid substituted at C-5 by ethyl and phenyl groups. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8069 |
|
| charge |
0 |
|
| database_cross_reference |
Drug_Central:2134 PMID:1992141 PMID:1495012 PMID:8035421 Beilstein:233363 PMID:7205879 PMID:3820228 PMID:9544213 PMID:3950919 PMID:16139502 PMID:3599019 Reaxys:233363 PMID:2724304 PMID:6716399 PMID:8230125 PMID:3336019 PMID:3783590 PMID:17481896 PMID:17827020 PMID:17300161 PMID:3950916 PMID:1875341 PMID:7562939 PMID:8246220 PMID:6864729 KEGG:D00506 PMID:2579237 PMID:10891117 PMID:1681105 PMID:2308141 PMID:8691481 PMID:3735320 PMID:16190747 PMID:15324906 PMID:8627613 PMID:16793262 DrugBank:DB01174 CAS:50-06-6 PMID:16789751 KEGG:C07434 PMID:12873507 PMID:10866370 PMID:12361404 PMID:17870541 PMID:15857133 PMID:7799408 PMID:3783589 PMID:2061925 PMID:2296016 PMID:3572984 PMID:3654008 Wikipedia:Phenobarbital PMID:11311072 PMID:2308142 PMID:3016269 PMID:9016327 PMID:2170646 Patent:US1025872 PMID:4032429 PMID:6737420 Gmelin:336231 PMID:7381857 HMDB:HMDB0015305 |
|
| definition |
A member of the class of barbiturates, the structure of which is that of barbituric acid substituted at C-5 by ethyl and phenyl groups. |
|
| formula |
C12H12N2O3 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_60798 http://purl.obolibrary.org/obo/CHEBI_35717 |
|
| has_alternative_id |
CHEBI:102217 |
|
| has_exact_synonym |
Phenobarbital 5-ethyl-5-phenylpyrimidine-2,4,6(1H,3H,5H)-trione |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Phenylethylmalonylurea Phenobarbitone PHENYLETHYLMALONYLUREA 5-ethyl-5-phenylpyrimidine-2,4,6(1H,3H,5H)-trione Phenylethylbarbiturate Phenobarbituric Acid 5-Phenyl-5-ethylbarbituric acid phenobarbital Phenylethylbarbitursaeure 5-Ethyl-5-phenylbarbituric acid 5-Ethyl-5-phenyl-pyrimidine-2,4,6-trione Phenobarbitol Phenylaethylbarbitursaeure 5-ethyl-5-phenyl-2,4,6(1H,3H,5H)-pyrimidinetrione Phenylethylbarbituric Acid Luminal |
|
| has_RxCUI |
8134 |
|
| id |
CHEBI:8069 |
|
| in_subset | ||
| inchi |
InChI=1S/C12H12N2O3/c1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16/h3-7H,2H2,1H3,(H2,13,14,15,16,17) |
|
| inchikey |
DDBREPKUVSBGFI-UHFFFAOYSA-N |
|
| is_bearer_of | ||
| label |
Phenobarbital phenobarbital |
|
| mass |
232.23530 |
|
| monoisotopicmass |
232.08479 |
|
| notation |
CHEBI:8069 |
|
| prefLabel |
Phenobarbital |
|
| smiles |
CCC1(C(=O)NC(=O)NC1=O)c1ccccc1 |
|
| subClassOf |