Preferred Name |
Chlorpropamide |
|
Synonyms |
CHLORPROPAMIDE clorpropamida 1-propyl-3-(p-chlorobenzenesulfonyl)urea 1-(p-chlorophenylsulfonyl)-3-propylurea 1-(p-chlorobenzenesulfonyl)-3-propylurea N-(4-chlorophenylsulfonyl)-N'-propylurea n-propyl-N'-p-chlorophenylsulfonylcarbamide 4-chloro-N-((propylamino)carbonyl)benzenesulfonamide chlorpropamide n-propyl-N'-(p-chlorobenzenesulfonyl)urea 4-chloro-N-[(propylamino)carbonyl]benzenesulfonamide N-(p-chlorobenzenesulfonyl)-N'-propylurea chlorpropamidum |
|
Definitions |
An N-sulfonylurea that is urea in which a hydrogen attached to one of the nitrogens is substituted by 4-chlorobenzenesulfonyl group and a hydrogen attached to the other nitrogen is substituted by propyl group. Chlorpropamide is a hypoglycaemic agent used in the treatment of type 2 (non-insulin-dependent) diabetes mellitus not responding to dietary modification. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3650 |
|
charge |
0 |
|
database_cross_reference |
DrugBank:DB00672 Wikipedia:Chlorpropamide LINCS:LSM-6695 PMID:2657066 KEGG:D00271 PMID:3806586 Reaxys:2218363 Drug_Central:622 PMID:10891117 Patent:US3349124 HMDB:HMDB0014810 Beilstein:2218363 CAS:94-20-2 Patent:GB853555 |
|
definition |
An N-sulfonylurea that is urea in which a hydrogen attached to one of the nitrogens is substituted by 4-chlorobenzenesulfonyl group and a hydrogen attached to the other nitrogen is substituted by propyl group. Chlorpropamide is a hypoglycaemic agent used in the treatment of type 2 (non-insulin-dependent) diabetes mellitus not responding to dietary modification. |
|
formula |
C10H13ClN2O3S |
|
has role | ||
has_alternative_id |
CHEBI:108516 |
|
has_exact_synonym |
CHLORPROPAMIDE |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
clorpropamida 1-propyl-3-(p-chlorobenzenesulfonyl)urea 1-(p-chlorophenylsulfonyl)-3-propylurea 1-(p-chlorobenzenesulfonyl)-3-propylurea N-(4-chlorophenylsulfonyl)-N'-propylurea n-propyl-N'-p-chlorophenylsulfonylcarbamide 4-chloro-N-((propylamino)carbonyl)benzenesulfonamide chlorpropamide n-propyl-N'-(p-chlorobenzenesulfonyl)urea 4-chloro-N-[(propylamino)carbonyl]benzenesulfonamide N-(p-chlorobenzenesulfonyl)-N'-propylurea chlorpropamidum |
|
has_RxCUI |
2404 |
|
id |
CHEBI:3650 |
|
in_subset | ||
inchi |
InChI=1S/C10H13ClN2O3S/c1-2-7-12-10(14)13-17(15,16)9-5-3-8(11)4-6-9/h3-6H,2,7H2,1H3,(H2,12,13,14) |
|
inchikey |
RKWGIWYCVPQPMF-UHFFFAOYSA-N |
|
label |
Chlorpropamide chlorpropamide |
|
mass |
276.74000 |
|
monoisotopicmass |
276.03354 |
|
notation |
CHEBI:3650 |
|
prefLabel |
Chlorpropamide |
|
smiles |
CCCNC(=O)NS(=O)(=O)c1ccc(Cl)cc1 |
|
subClassOf |