Jump to:
loading...| Preferred Name |
Glutamate |
|
| Synonyms |
glutamate(2-) 2-aminopentanedioate glutamate glutamic acid dianion |
|
| Definitions |
A dicarboxylic acid dianion that is the conjugate base of glutamate(1-). |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_29987 |
|
| charge |
-2 |
|
| database_cross_reference |
Beilstein:4134100 Gmelin:327903 Reaxys:4134100 |
|
| definition |
A dicarboxylic acid dianion that is the conjugate base of glutamate(1-). |
|
| formula |
C5H7NO4 |
|
| has role | ||
| has_exact_synonym |
glutamate(2-) 2-aminopentanedioate glutamate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
glutamic acid dianion |
|
| has_RxCUI |
70602 |
|
| id |
CHEBI:29987 |
|
| in_subset | ||
| inchi |
InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/p-2 |
|
| inchikey |
WHUUTDBJXJRKMK-UHFFFAOYSA-L |
|
| is conjugate base of | ||
| label |
glutamate(2-) Glutamate |
|
| mass |
145.11342 |
|
| monoisotopicmass |
145.03860 |
|
| notation |
CHEBI:29987 |
|
| prefLabel |
Glutamate |
|
| smiles |
NC(CCC([O-])=O)C([O-])=O |
|
| subClassOf |
Create mapping