loading...| Preferred Name |
proline |
|
| Synonyms |
proline pyrrolidine-2-carboxylic acid DL-Proline Hpro Prolin prolina |
|
| Definitions |
An alpha-amino acid that is pyrrolidine bearing a carboxy substituent at position 2. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_26271 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:21903295 PMID:21400017 Reaxys:80809 PMID:22280966 KEGG:C16435 Gmelin:26927 PMID:22264337 Wikipedia:Proline Beilstein:80809 PMID:22770225 PMID:16534801 CAS:609-36-9 |
|
| formula |
C5H9NO2 |
|
| has exact synonym |
proline |
|
| has role | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
pyrrolidine-2-carboxylic acid DL-Proline Hpro Prolin prolina |
|
| id |
CHEBI:26271 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8) |
|
| inchikey |
ONIBWKKTOPOVIA-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| label |
proline |
|
| mass |
115.13050 |
|
| monoisotopicmass |
115.06333 |
|
| notation |
CHEBI:26271 |
|
| prefLabel |
proline |
|
| smiles |
OC(=O)C1CCCN1 |
|
| textual definition |
An alpha-amino acid that is pyrrolidine bearing a carboxy substituent at position 2. |
|
| subClassOf |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.