Preferred Name |
busulfan |
|
Synonyms |
butane-1,4-diyl dimethanesulfonate Busulfan 1,4-Dimesyloxybutane Tetramethylene bis(methanesulfonate) Myeloleukon 1,4-Dimethanesulfonoxybutane 1,4-Bis(methanesulfonoxy)butane Leucosulfan 1,4-Butanediol dimethanesulfonate Bisulfex Mablin Mielucin Misulban Mitostan Myleran busulfan busulfano busulfanum |
|
Definitions |
A methanesulfonate ester that is butane-1,4-diol in which the hydrogens of the hydroxy groups are replaced by methanesulfonyl groups. An alkylating antineoplastic agent, it is used for the treatment of chronic myeloid leukemia (although it has been largely replaced by newer drugs). It is also used as an insect sterilant. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_28901 |
|
charge |
0 |
|
database_cross_reference |
KEGG:C06862 KEGG:D00248 PMID:10523796 PMID:19611402 CAS:55-98-1 Drug_Central:438 PMID:19361744 Reaxys:1791786 DrugBank:DB01008 LINCS:LSM-5388 Beilstein:1791786 Patent:US2917432 Wikipedia:Busulfan |
|
definition |
A methanesulfonate ester that is butane-1,4-diol in which the hydrogens of the hydroxy groups are replaced by methanesulfonyl groups. An alkylating antineoplastic agent, it is used for the treatment of chronic myeloid leukemia (although it has been largely replaced by newer drugs). It is also used as an insect sterilant. |
|
formula |
C6H14O6S2 |
|
has_alternative_id |
CHEBI:18936 CHEBI:3225 |
|
has_exact_synonym |
butane-1,4-diyl dimethanesulfonate Busulfan |
|
has_functional_parent | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
1,4-Dimesyloxybutane Tetramethylene bis(methanesulfonate) Myeloleukon 1,4-Dimethanesulfonoxybutane 1,4-Bis(methanesulfonoxy)butane Leucosulfan 1,4-Butanediol dimethanesulfonate Bisulfex Mablin Mielucin Misulban Mitostan Myleran busulfan busulfano busulfanum |
|
id |
CHEBI:28901 |
|
in_subset | ||
inchi |
InChI=1S/C6H14O6S2/c1-13(7,8)11-5-3-4-6-12-14(2,9)10/h3-6H2,1-2H3 |
|
inchikey |
COVZYZSDYWQREU-UHFFFAOYSA-N |
|
label |
busulfan |
|
mass |
246.30200 |
|
monoisotopicmass |
246.02318 |
|
notation |
CHEBI:28901 |
|
prefLabel |
busulfan |
|
RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_50905 http://purl.obolibrary.org/obo/CHEBI_35610 http://purl.obolibrary.org/obo/CHEBI_67105 |
|
smiles |
CS(=O)(=O)OCCCCOS(C)(=O)=O |
|
subClassOf |