Preferred Name | salicylate | |
Synonyms |
2-hydroxybenzoic acid ion(1-) o-hydroxybenzoate sal 2-hydroxybenzoate Salicylate salicylate |
|
Definitions |
A monohydroxybenzoate that is the conjugate base of salicylic acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_30762 |
|
bearer of | ||
charge |
-1 |
|
database_cross_reference |
PMID:16669002 PMID:16934829 Reaxys:3605209 Beilstein:3605209 CAS:63-36-5 KEGG:C00805 Gmelin:3417 UM-BBD_compID:c0043 |
|
formula |
C7H5O3 |
|
has role | ||
has_alternative_id |
CHEBI:26595 CHEBI:15061 |
|
has_exact_synonym |
2-hydroxybenzoate Salicylate salicylate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2-hydroxybenzoic acid ion(1-) o-hydroxybenzoate sal |
|
id |
CHEBI:30762 |
|
in_subset | ||
inchi |
InChI=1S/C7H6O3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H,(H,9,10)/p-1 |
|
inchikey |
YGSDEFSMJLZEOE-UHFFFAOYSA-M |
|
is_conjugate_base_of | ||
label |
salicylate |
|
mass |
137.11280 |
|
monoisotopicmass |
137.02442 |
|
notation |
CHEBI:30762 |
|
prefLabel |
salicylate |
|
smiles |
Oc1ccccc1C([O-])=O |
|
textual definition |
A monohydroxybenzoate that is the conjugate base of salicylic acid. |
|
subClassOf |
Create mapping