loading...| Preferred Name | uracil | |
| Synonyms |
Urazil ISAKRJDGNUQOIC-UHFFFAOYSA-N 2,4-Pyrimidinedione 2,4(1H,3H)-pyrimidinedione 2,4-Dioxopyrimidine Ura O=c1cc[nH]c(=O)[nH]1 InChI=1S/C4H4N2O2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8) U 112.08684 C4H4N2O2 Uracil URACIL uracil pyrimidine-2,4(1H,3H)-dione |
|
| Definitions |
A common and naturally occurring pyrimidine nucleobase in which the pyrimidine ring is substituted with two oxo groups at positions 2 and 4. Found in RNA, it base pairs with adenine and replaces thymine during DNA transcription. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17568 |
|
| database_cross_reference |
PMID:11279060 PMID:22074393 KEGG:D00027 PMID:18815805 Reaxys:606623 PMID:18533995 PMID:22171528 KNApSAcK:C00001513 MetaCyc:URACIL PMID:22356544 PMID:15274295 PMID:17439666 PMID:22685418 PMID:16834123 PMID:3654008 HMDB:HMDB00300 PMID:22020693 PMID:12855717 Gmelin:2896 PMID:22237209 PDBeChem:URA PMID:22299724 Beilstein:606623 Wikipedia:Uracil PMID:22567906 DrugBank:DB03419 KEGG:C00106 PMID:22483865 PMID:22120518 PMID:22447672 PMID:19175333 CAS:66-22-8 |
|
| definition |
A common and naturally occurring pyrimidine nucleobase in which the pyrimidine ring is substituted with two oxo groups at positions 2 and 4. Found in RNA, it base pairs with adenine and replaces thymine during DNA transcription. |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_83056 http://purl.obolibrary.org/obo/CHEBI_75772 http://purl.obolibrary.org/obo/CHEBI_77746 http://purl.obolibrary.org/obo/CHEBI_75771 |
|
| has_alternative_id |
CHEBI:46375 CHEBI:15288 CHEBI:27210 CHEBI:9882 |
|
| has_exact_synonym |
Uracil URACIL uracil pyrimidine-2,4(1H,3H)-dione |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Urazil ISAKRJDGNUQOIC-UHFFFAOYSA-N 2,4-Pyrimidinedione 2,4(1H,3H)-pyrimidinedione 2,4-Dioxopyrimidine Ura O=c1cc[nH]c(=O)[nH]1 InChI=1S/C4H4N2O2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8) U 112.08684 C4H4N2O2 |
|
| id |
CHEBI:17568 |
|
| imported from | ||
| is tautomer of | ||
| label |
uracil |
|
| notation |
CHEBI:17568 |
|
| prefLabel |
uracil |
|
| subClassOf |