Preferred Name |
phenylalanine |
|
Synonyms |
|
|
Definitions |
An aromatic amino acid that is alanine in which one of the methyl hydrogens is substituted by a phenyl group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_28044 |
|
charge |
0 |
|
definition |
An aromatic amino acid that is alanine in which one of the methyl hydrogens is substituted by a phenyl group. |
|
formula |
C9H11NO2 |
|
has characteristic | ||
has part | ||
has role | ||
inchi |
InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12) |
|
inchikey |
COLNVLDHVKWLRT-UHFFFAOYSA-N |
|
is_conjugate_acid_of | ||
is_conjugate_base_of | ||
label |
phenylalanine |
|
mass |
165.18918 |
|
monoisotopicmass |
165.07898 |
|
overlaps | ||
prefixIRI |
CHEBI:28044 |
|
prefLabel |
phenylalanine |
|
smiles |
NC(Cc1ccccc1)C(O)=O |
|
subClassOf |
Create mapping