Preferred Name |
cysteine |
|
Synonyms |
|
|
Definitions |
A sulfur-containing amino acid that is propanoic acid with an amino group at position 2 and a sulfanyl group at position 3. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_15356 |
|
charge |
0 |
|
definition |
A sulfur-containing amino acid that is propanoic acid with an amino group at position 2 and a sulfanyl group at position 3. |
|
formula |
C3H7NO2S |
|
has part | ||
has role | ||
inchi |
InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6) |
|
inchikey |
XUJNEKJLAYXESH-UHFFFAOYSA-N |
|
is_conjugate_acid_of | ||
is_conjugate_base_of | ||
is_tautomer_of | ||
label |
cysteine |
|
mass |
121.15922 |
|
monoisotopicmass |
121.01975 |
|
prefixIRI |
CHEBI:15356 |
|
prefLabel |
cysteine |
|
smiles |
NC(CS)C(O)=O |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_26834 |
Create mapping