Preferred Name | naphthalene | |
Synonyms |
naphtaline naftalina Naphthalen naftaleno Naphthalin naphtalene Naphthalene naphthalene NAPHTHALENE |
|
Definitions |
An aromatic hydrocarbon comprising two fused benzene rings. It occurs in the essential oils of numerous plant species e.g. magnolia. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16482 |
|
alternative label |
naphtaline naftalina Naphthalen naftaleno Naphthalin naphtalene Naphthalene naphthalene NAPHTHALENE |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Naphthalene Beilstein:1421310 PMID:11202734 PDBeChem:NPY PPDB:1312 Reaxys:1421310 UM-BBD_compID:c0333 PMID:10814889 KNApSAcK:C00001259 Gmelin:3347 PMID:26875834 PMID:27439360 MetaCyc:NAPHTHALENE PMID:16699520 HMDB:HMDB0029751 KEGG:C00829 CAS:91-20-3 PMID:16220979 PMID:17850896 PMID:26895256 |
|
definition |
An aromatic hydrocarbon comprising two fused benzene rings. It occurs in the essential oils of numerous plant species e.g. magnolia. |
|
formula |
C10H8 |
|
has characteristic |
http://purl.obolibrary.org/obo/CHEBI_27311 http://purl.obolibrary.org/obo/CHEBI_68494 |
|
has exact synonym |
Naphthalene naphthalene NAPHTHALENE |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_27311 http://purl.obolibrary.org/obo/CHEBI_68494 |
|
has_alternative_id |
CHEBI:14638 CHEBI:25469 CHEBI:44619 CHEBI:7472 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
naphtaline naftalina Naphthalen naftaleno Naphthalin naphtalene |
|
id |
CHEBI:16482 |
|
in_subset | ||
inchi |
InChI=1S/C10H8/c1-2-6-10-8-4-3-7-9(10)5-1/h1-8H |
|
inchikey |
UFWIBTONFRDIAS-UHFFFAOYSA-N |
|
label |
naphthalene |
|
mass |
128.17052 |
|
monoisotopicmass |
128.06260 |
|
notation |
CHEBI:16482 |
|
note |
An aromatic hydrocarbon comprising two fused benzene rings. It occurs in the essential oils of numerous plant species e.g. magnolia. |
|
preferred label |
naphthalene |
|
prefLabel |
naphthalene |
|
smiles |
c1ccc2ccccc2c1 |
|
subClassOf |