loading...| Preferred Name | L-glutamic acid | |
| Synonyms |
acidum glutamicum L-Glutaminic acid L-Glutaminsaeure glutamic acid GLUTAMIC ACID (S)-glutamic acid E Glu L-Glu acide glutamique acido glutamico Glutamate (S)-2-aminopentanedioic acid (2S)-2-aminopentanedioic acid L-glutamic acid L-Glutamic acid |
|
| Definitions |
An optically active form of glutamic acid having L-configuration. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16015 |
|
| alternative label |
acidum glutamicum L-Glutaminic acid L-Glutaminsaeure glutamic acid GLUTAMIC ACID (S)-glutamic acid E Glu L-Glu acide glutamique acido glutamico Glutamate (S)-2-aminopentanedioic acid (2S)-2-aminopentanedioic acid L-glutamic acid L-Glutamic acid |
|
| charge |
0 |
|
| database_cross_reference |
PMID:15739367 PDBeChem:GLU_LFOH CAS:56-86-0 HMDB:HMDB0000148 PMID:16719819 KEGG:D00007 MetaCyc:GLT Wikipedia:L-Glutamic_Acid PMID:16892196 KNApSAcK:C00001358 LINCS:LSM-36375 DrugBank:DB00142 PMID:22735334 PMID:19581495 KEGG:C00025 BPDB:2297 Reaxys:1723801 Drug_Central:1310 Beilstein:1723801 Gmelin:3502 PMID:22219301 PMID:15930465 |
|
| definition |
An optically active form of glutamic acid having L-configuration. |
|
| formula |
C5H9NO4 |
|
| has characteristic |
http://purl.obolibrary.org/obo/CHEBI_25512 http://purl.obolibrary.org/obo/CHEBI_173085 http://purl.obolibrary.org/obo/CHEBI_75771 http://purl.obolibrary.org/obo/CHEBI_27027 |
|
| has exact synonym |
(2S)-2-aminopentanedioic acid L-glutamic acid L-Glutamic acid |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_25512 http://purl.obolibrary.org/obo/CHEBI_173085 http://purl.obolibrary.org/obo/CHEBI_75771 http://purl.obolibrary.org/obo/CHEBI_27027 |
|
| has_alternative_id |
CHEBI:42825 CHEBI:21304 CHEBI:6224 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
acidum glutamicum L-Glutaminic acid L-Glutaminsaeure glutamic acid GLUTAMIC ACID (S)-glutamic acid E Glu L-Glu acide glutamique acido glutamico Glutamate (S)-2-aminopentanedioic acid |
|
| id |
CHEBI:16015 |
|
| in_subset | ||
| inchi |
InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m0/s1 |
|
| inchikey |
WHUUTDBJXJRKMK-VKHMYHEASA-N |
|
| is conjugate acid of | ||
| is enantiomer of | ||
| label |
L-glutamic acid |
|
| mass |
147.12930 |
|
| monoisotopicmass |
147.05316 |
|
| notation |
CHEBI:16015 |
|
| note |
An optically active form of glutamic acid having L-configuration. |
|
| preferred label |
L-glutamic acid |
|
| prefLabel |
L-glutamic acid |
|
| smiles |
N[C@@H](CCC(O)=O)C(O)=O |
|
| subClassOf |