loading...| Preferred Name | glutamine | |
| Synonyms |
glutamic acid gamma-amide Hgln NC(CCC(N)=O)C(O)=O C5H10N2O3 2-amino-4-carbamoylbutanoic acid InChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10) Glutamin 2-Aminoglutaramic acid Glutaminsaeure-5-amid 146.069 ZDXPYRJPNDTMRX-UHFFFAOYSA-N 0 146.14458 2,5-diamino-5-oxopentanoic acid glutamine Glutamine |
|
| Definitions |
An alpha-amino acid that consists of butyric acid bearing an amino substituent at position 2 and a carbamoyl substituent at position 4. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28300 |
|
| database_cross_reference |
colombos:GLUTAMINE CAS:6899-04-3 Beilstein:1723795 Wikipedia:Glutamine Reaxys:1723795 KEGG:C00303 CAS:585-21-7 Gmelin:27318 KNApSAcK:C00001359 |
|
| has exact synonym |
glutamine Glutamine |
|
| has part | ||
| has role | ||
| has_alternative_id |
CHEBI:24316 CHEBI:5432 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
glutamic acid gamma-amide Hgln NC(CCC(N)=O)C(O)=O C5H10N2O3 2-amino-4-carbamoylbutanoic acid InChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10) Glutamin 2-Aminoglutaramic acid Glutaminsaeure-5-amid 146.069 ZDXPYRJPNDTMRX-UHFFFAOYSA-N 0 146.14458 2,5-diamino-5-oxopentanoic acid |
|
| id |
CHEBI:28300 |
|
| in_subset | ||
| is conjugate acid of | ||
| is conjugate base of | ||
| label |
glutamine |
|
| notation |
CHEBI:28300 |
|
| prefLabel |
glutamine |
|
| textual definition |
An alpha-amino acid that consists of butyric acid bearing an amino substituent at position 2 and a carbamoyl substituent at position 4. |
|
| subClassOf |