loading...| Preferred Name | phenylalanine | |
| Synonyms |
PHE NC(Cc1ccccc1)C(O)=O Phenylalanin DL-Phenylalanine alpha-Amino-beta-phenylpropionic acid InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12) F 165.18918 fenilalanina 165.079 COLNVLDHVKWLRT-UHFFFAOYSA-N 0 C9H11NO2 Phenylalanine 2-amino-3-phenylpropanoic acid phenylalanine |
|
| Definitions |
An aromatic amino acid that is alanine in which one of the methyl hydrogens is substituted by a phenyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28044 |
|
| database_cross_reference |
Beilstein:1910407 Gmelin:50836 Wikipedia:Phenylalanine PMID:22264337 PMID:17439666 Reaxys:1910407 KEGG:C02057 CAS:150-30-1 |
|
| has exact synonym |
Phenylalanine 2-amino-3-phenylpropanoic acid phenylalanine |
|
| has part | ||
| has role | ||
| has_alternative_id |
CHEBI:8089 CHEBI:25984 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
PHE NC(Cc1ccccc1)C(O)=O Phenylalanin DL-Phenylalanine alpha-Amino-beta-phenylpropionic acid InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12) F 165.18918 fenilalanina 165.079 COLNVLDHVKWLRT-UHFFFAOYSA-N 0 C9H11NO2 |
|
| id |
CHEBI:28044 |
|
| in_subset | ||
| is conjugate acid of | ||
| is conjugate base of | ||
| label |
phenylalanine |
|
| notation |
CHEBI:28044 |
|
| prefLabel |
phenylalanine |
|
| textual definition |
An aromatic amino acid that is alanine in which one of the methyl hydrogens is substituted by a phenyl group. |
|
| subClassOf |