Link to this page
Microbial Conditions Ontology
Last uploaded:
September 4, 2019
Jump to:
Preferred Name | valeric acid | |
Synonyms |
CH3-[CH2]3-COOH pentoic acid n-pentanoic acid InChI=1S/C5H10O2/c1-2-3-4-5(6)7/h2-4H2,1H3,(H,6,7) 102.13170 C5H10O2 valeric acid, normal Pentanoate propylacetic acid 102.068 Valerianic acid Valerate CCCCC(O)=O n-BuCOOH NQPDZGIKBAWPEJ-UHFFFAOYSA-N n-Pentanoate Valeriansaeure 1-butanecarboxylic acid 0 Pentanoic acid PENTANOIC ACID n-Valeric acid n-valeric acid Valeric acid pentanoic acid |
|
Definitions |
A straight-chain saturated fatty acid containing five carbon atoms. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17418 |
|
database_cross_reference |
LIPID_MAPS_instance:LMFA01010005 Beilstein:969454 PMID:20507156 Gmelin:26714 Reaxys:969454 HMDB:HMDB00892 KEGG:C00803 CAS:109-52-4 DrugBank:DB02406 PDBeChem:PEI KNApSAcK:C00001208
|
|
has exact synonym |
Valeric acid pentanoic acid
|
|
has role | ||
has_alternative_id |
CHEBI:44803 CHEBI:27264 CHEBI:7980 CHEBI:43606 CHEBI:27263 CHEBI:113448
|
|
has_obo_namespace |
chebi_ontology
|
|
has_related_synonym |
CH3-[CH2]3-COOH pentoic acid n-pentanoic acid InChI=1S/C5H10O2/c1-2-3-4-5(6)7/h2-4H2,1H3,(H,6,7) 102.13170 C5H10O2 valeric acid, normal Pentanoate propylacetic acid 102.068 Valerianic acid Valerate CCCCC(O)=O n-BuCOOH NQPDZGIKBAWPEJ-UHFFFAOYSA-N n-Pentanoate Valeriansaeure 1-butanecarboxylic acid 0 Pentanoic acid PENTANOIC ACID n-Valeric acid n-valeric acid
|
|
id |
CHEBI:17418
|
|
in_subset | ||
is conjugate acid of | ||
label |
valeric acid
|
|
notation |
CHEBI:17418
|
|
prefLabel |
valeric acid
|
|
textual definition |
A straight-chain saturated fatty acid containing five carbon atoms.
|
|
subClassOf |
Add comment
Delete | Subject | Author | Type | Created |
---|---|---|---|---|
No notes to display |
Create mapping