Preferred Name |
glycine |
|
Synonyms |
Glycine glycine GLYCINE aminoacetic acid Glyzin NCC(O)=O InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5) G Glycocoll Leimzucker Hgly H2N-CH2-COOH Aminoessigsaeure C2H5NO2 DHMQDGOQFOQNFH-UHFFFAOYSA-N Gly 75.06664 aminoethanoic acid 75.032 Glykokoll 0 Aminoacetic acid Glycin |
|
Definitions |
The simplest (and the only achiral) proteinogenic amino acid, with a hydrogen atom as its side chain. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_15428 |
|
database_cross_reference |
PMID:22434786 KNApSAcK:C00001361 PMID:22079563 PMID:11806864 PMID:11019925 PMID:16214212 PDBeChem:GLY PMID:11542461 PMID:22293292 PMID:16664855 PMID:16417482 Reaxys:635782 PMID:18079355 PMID:19449910 PMID:22264337 PMID:12921899 YMDB:YMDB00016 PMID:22044190 PMID:18816054 PMID:19526731 Wikipedia:Glycine PMID:16105183 PMID:16151895 PMID:16998855 PMID:19924257 PMID:11174716 PMID:12754315 PMID:16918424 PMID:19916621 PMID:15331688 PMID:19738917 PMID:18440992 Drug_Central:1319 PMID:19544666 PMID:17383967 PMID:18396796 PMID:18593588 PMID:12631515 PMID:19028609 PMID:15388434 PMID:10930630 PMID:19120667 PMID:17970719 KEGG:C00037 PMID:16986325 PMID:12770151 MetaCyc:GLY PMID:17154252 DrugBank:DB00145 PMID:16444815 PMID:22401276 KEGG:D00011 CAS:56-40-6 PMID:16901953 PMID:15710237 PMID:21751272 Gmelin:1808 PMID:18840508 PMID:17582620 Beilstein:635782 ECMDB:ECMDB00123 PMID:22234938 HMDB:HMDB00123 |
|
has biological role in Escherichia coli | ||
has exact synonym |
Glycine glycine GLYCINE aminoacetic acid |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_64570 http://purl.obolibrary.org/obo/CHEBI_25512 http://purl.obolibrary.org/obo/CHEBI_62868 http://purl.obolibrary.org/obo/CHEBI_78675 http://purl.obolibrary.org/obo/CHEBI_27027 |
|
has_alternative_id |
CHEBI:24368 CHEBI:10792 CHEBI:5460 CHEBI:14344 CHEBI:42964 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Glyzin NCC(O)=O InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5) G Glycocoll Leimzucker Hgly H2N-CH2-COOH Aminoessigsaeure C2H5NO2 DHMQDGOQFOQNFH-UHFFFAOYSA-N Gly 75.06664 aminoethanoic acid 75.032 Glykokoll 0 Aminoacetic acid Glycin |
|
id |
CHEBI:15428 |
|
in_subset | ||
is conjugate acid of | ||
is conjugate base of | ||
is tautomer of | ||
label |
glycine |
|
notation |
CHEBI:15428 |
|
prefLabel |
glycine |
|
textual definition |
The simplest (and the only achiral) proteinogenic amino acid, with a hydrogen atom as its side chain. |
|
subClassOf |