Preferred Name |
cholesterol |
|
Synonyms |
|
|
Definitions |
A cholestanoid consisting of cholestane having a double bond at the 5,6-position as well as a 3β-hydroxy group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16113 |
|
database cross reference |
Wikipedia:cholesterol |
|
definition |
A cholestanoid consisting of cholestane having a double bond at the 5,6-position as well as a 3β-hydroxy group. |
|
formula |
C27H46O |
|
label |
cholesterol |
|
prefixIRI |
CHEBI:16113 |
|
prefLabel |
cholesterol |
|
smiles |
C1[C@@]2([C@]3(CC[C@]4([C@]([C@@]3(CC=C2C[C@H](C1)O)[H])(CC[C@@]4([C@H](C)CCCC(C)C)[H])[H])C)[H])C |
|
subClassOf |
Create mapping