Jump to:
loading...| Preferred Name | alditol | |
| Synonyms |
InChI=1S/C3H8O3/c4-1-3(6)2-5/h3-6H,1-2H2 alditols Glycitol C2H6O2(CH2O)n C3H8O3 InChIKey=PEDCQBHIVMGVHV-UHFFFAOYSA-N Sugar alcohol Alditol |
|
| Definitions |
A carbohydrate that is an acyclic polyol having the general formula HOCH2[CH(OH)]nCH2OH (formally derivable from an aldose by reduction of the carbonyl group). |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17522 |
|
| database_cross_reference |
Wikipedia:Glycerin KEGG COMPOUND:C00717 |
|
| definition |
A carbohydrate that is an acyclic polyol having the general formula HOCH2[CH(OH)]nCH2OH (formally derivable from an aldose by reduction of the carbonyl group). |
|
| has_alternative_id |
CHEBI:2556 CHEBI:13754 CHEBI:22298 |
|
| has_exact_synonym |
Alditol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
InChI=1S/C3H8O3/c4-1-3(6)2-5/h3-6H,1-2H2 alditols Glycitol C2H6O2(CH2O)n C3H8O3 InChIKey=PEDCQBHIVMGVHV-UHFFFAOYSA-N Sugar alcohol |
|
| id |
CHEBI:17522 |
|
| imported from | ||
| label |
alditol |
|
| notation |
CHEBI:17522 |
|
| prefLabel |
alditol |
|
| subClassOf |
Create mapping