loading...| Preferred Name | dimethyl sulfoxide | |
| Synonyms |
dimetil sulfoxido dimethyl sulphoxide dimethyl sulfur oxide Dimethylsulfoxid methylsulfinylmethane dimethyli sulfoxidum dimethylsulfoxyde dimethyl sulfoxide sulfinylbis(methane) (CH3)2SO DMSO S(O)Me2 dmso DIMETHYL SULFOXIDE Dimethyl sulfoxide (methanesulfinyl)methane |
|
| Definitions |
A 2-carbon sulfoxide in which the sulfur atom has two methyl substituents. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28262 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:22030943 PMID:22814967 PMID:12663039 PMID:6379027 PMID:31489176 PMID:28220525 PMID:19443933 PMID:23050031 KNApSAcK:C00053120 KEGG DRUG:D01043 NIST Chemistry WebBook:67-68-5 PMID:21426213 Drug_Central:906 CAS:67-68-5 CiteXplore:15588915 ChEMBL:110009 PMID:19382398 PMID:29938311 PMID:3916302 PMID:4223708 PMID:10298633 PMID:15868171 PMID:11350866 UM-BBD:c0236 PMID:3898376 PMID:20828537 Reaxys:506008 MetaCyc:DMSO Beilstein:506008 PDBeChem:DMS Wikipedia:Dimethyl_Sulfoxide PMID:6309056 FooDB:FDB000764 PMID:11162043 UM-BBD_compID:c0236 DrugBank:DB01093 PMID:16434015 PMID:4963226 MeSH:D004121 PMID:4556944 PMID:22768202 PMID:3510103 HMDB:HMDB0002151 PMID:19096138 PMID:15237653 CiteXplore:22030943 CiteXplore:21426213 KEGG COMPOUND:67-68-5 Gmelin:1556 KEGG COMPOUND:C11143 KEGG:D01043 Wikipedia:Dimethyl_sulfoxide Chemspider:659 ChemIDplus:67-68-5 PMID:23313473 PMID:22722716 PMID:16522014 KEGG:C11143 CiteXplore:11350866 LINCS:LSM-36361 PMID:15588915 PMID:11474739 NCIt:C437 |
|
| definition |
A 2-carbon sulfoxide in which the sulfur atom has two methyl substituents. |
|
| formula |
C2H6OS |
|
| has_alternative_id |
CHEBI:42138 CHEBI:23801 CHEBI:4612 |
|
| has_exact_synonym |
DIMETHYL SULFOXIDE Dimethyl sulfoxide dimethyl sulfoxide (methanesulfinyl)methane |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
dimetil sulfoxido dimethyl sulphoxide dimethyl sulfur oxide Dimethylsulfoxid methylsulfinylmethane dimethyli sulfoxidum dimethylsulfoxyde dimethyl sulfoxide sulfinylbis(methane) (CH3)2SO DMSO S(O)Me2 dmso |
|
| id |
CHEBI:28262 |
|
| in_subset | ||
| inchi |
InChI=1S/C2H6OS/c1-4(2)3/h1-2H3 |
|
| inchikey |
IAZDPXIOMUYVGZ-UHFFFAOYSA-N |
|
| label |
dimethyl sulfoxide |
|
| mass |
78.13444 |
|
| monoisotopicmass |
78.01394 |
|
| notation |
CHEBI:28262 |
|
| preferred label |
dimethyl sulfoxide |
|
| prefLabel |
dimethyl sulfoxide |
|
| smiles |
CS(C)=O |
|
| subClassOf |