Jump to:
loading...| Preferred Name | noradrenaline | |
| Synonyms |
norepinephrine noradrenalina 4-(2-amino-1-hydroxyethyl)benzene-1,2-diol |
|
| Definitions |
A catecholamine in which C-1 of the aminoethyl side-chain is hydroxy-substituted. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_33569 |
|
| alternative label |
norepinephrine noradrenalina 4-(2-amino-1-hydroxyethyl)benzene-1,2-diol |
|
| charge |
0 |
|
| database_cross_reference |
CAS:138-65-8 LINCS:LSM-5181 Gmelin:863925 Beilstein:2210994 |
|
| definition |
A catecholamine in which C-1 of the aminoethyl side-chain is hydroxy-substituted. |
|
| formula |
C8H11NO3 |
|
| has role | ||
| has_exact_synonym |
4-(2-amino-1-hydroxyethyl)benzene-1,2-diol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
norepinephrine noradrenalina |
|
| id |
CHEBI:33569 |
|
| in_subset | ||
| inchi |
InChI=1S/C8H11NO3/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8,10-12H,4,9H2 |
|
| inchikey |
SFLSHLFXELFNJZ-UHFFFAOYSA-N |
|
| is conjugate base of | ||
| label |
noradrenaline |
|
| mass |
169.17788 |
|
| monoisotopicmass |
169.07389 |
|
| notation |
CHEBI:33569 |
|
| prefLabel |
noradrenaline |
|
| smiles |
NCC(O)c1ccc(O)c(O)c1 |
|
| subClassOf |
Create mapping