loading...| Preferred Name | L-phenylalanine | |
| Synonyms |
(S)-alpha-Amino-beta-phenylpropionic acid beta-phenyl-L-alanine PHENYLALANINE 3-phenyl-L-alanine (S)-2-Amino-3-phenylpropionic acid F Phe L-phenylalanine (2S)-2-amino-3-phenylpropanoic acid L-Phenylalanine |
|
| Definitions |
The L-enantiomer of phenylalanine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17295 |
|
| alternative label |
(S)-alpha-Amino-beta-phenylpropionic acid beta-phenyl-L-alanine PHENYLALANINE 3-phenyl-L-alanine (S)-2-Amino-3-phenylpropionic acid F Phe L-phenylalanine (2S)-2-amino-3-phenylpropanoic acid L-Phenylalanine |
|
| charge |
0 |
|
| database_cross_reference |
PMID:16893175 PMID:24966042 Reaxys:1910408 DrugBank:DB00120 YMDB:YMDB00304 MetaCyc:PHE PMID:23836015 PMID:22081386 Gmelin:50837 PDBeChem:PHE KEGG:C00079 PMID:22209218 PMID:22112574 PMID:21203787 PMID:21956539 Drug_Central:2144 PMID:22143120 CAS:63-91-2 PMID:24733517 Wikipedia:Phenylalanine PMID:17784858 KEGG:D00021 HMDB:HMDB0000159 KNApSAcK:C00001386 ECMDB:ECMDB00159 PMID:24464217 Beilstein:1910408 PMID:13945318 PMID:22494897 |
|
| definition |
The L-enantiomer of phenylalanine. |
|
| formula |
C9H11NO2 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_75772 http://purl.obolibrary.org/obo/CHEBI_63332 http://purl.obolibrary.org/obo/CHEBI_75771 http://purl.obolibrary.org/obo/CHEBI_27027 http://purl.obolibrary.org/obo/CHEBI_76971 http://purl.obolibrary.org/obo/CHEBI_76967 |
|
| has_alternative_id |
CHEBI:44885 CHEBI:21370 CHEBI:44851 CHEBI:45079 CHEBI:13151 CHEBI:6282 |
|
| has_exact_synonym |
L-phenylalanine (2S)-2-amino-3-phenylpropanoic acid L-Phenylalanine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(S)-alpha-Amino-beta-phenylpropionic acid beta-phenyl-L-alanine PHENYLALANINE 3-phenyl-L-alanine (S)-2-Amino-3-phenylpropionic acid F Phe |
|
| id |
CHEBI:17295 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1 |
|
| inchikey |
COLNVLDHVKWLRT-QMMMGPOBSA-N |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| is enantiomer of | ||
| is tautomer of | ||
| label |
L-phenylalanine |
|
| mass |
165.18918 |
|
| monoisotopicmass |
165.07898 |
|
| notation |
CHEBI:17295 |
|
| prefLabel |
L-phenylalanine |
|
| smiles |
N[C@@H](Cc1ccccc1)C(O)=O |
|
| subClassOf |