loading...| Preferred Name | xanthine | |
| Synonyms |
C5H4N4O2 2,3,6,7-tetrahydro-1H-purine-2,6-dione |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB02134 |
|
| binds | ||
| CASRN |
69-89-6 |
|
| Definition |
A purine base found in most body tissues and fluids, certain plants, and some urinary calculi. It is an intermediate in the degradation of adenosine monophosphate to uric acid, being formed by oxidation of hypoxanthine. The methylated xanthine compounds caffeine, theobromine, and theophylline and their derivatives are used in medicine for their bronchodilator effects. (Dorland, 28th ed) |
|
| InChI |
InChI=1S/C5H4N4O2/c10-4-2-3(7-1-6-2)8-5(11)9-4/h1H,(H3,6,7,8,9,10,11) |
|
| InChIKey |
InChIKey=LRFVTYWOQMYALW-UHFFFAOYSA-N |
|
| label |
xanthine |
|
| prefixIRI |
obo2:dinto_DB02134 |
|
| prefLabel |
xanthine |
|
| related with | ||
| SMILES |
O=C1NC2=C(NC=N2)C(=O)N1 |
|
| Synonym |
C5H4N4O2 2,3,6,7-tetrahydro-1H-purine-2,6-dione |
|
| xref |
ChemSpider:1151 PubChem Substance:46507575 PDB:XAN ChEBI:17712 PubChem Compound:1188 Wikipedia:http://en.wikipedia.org/wiki/Xanthine |
|
| subClassOf |