Preferred Name | Testosterone | |
Synonyms |
testosterona 4-androsten-17beta-ol-3-one 17beta-Hydroxy-4-androsten-3-one 17beta-hydroxy-4-androsten-3-one Testosteron testosterone testosteronum Androderm 17beta-hydroxyandrost-4-en-3-one TESTOSTERONE Testosterone |
|
Definitions |
An androstanoid having 17beta-hydroxy and 3-oxo groups, together with unsaturation at C-4-C-5.. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17347 |
|
alternative label |
testosterona 4-androsten-17beta-ol-3-one 17beta-Hydroxy-4-androsten-3-one 17beta-hydroxy-4-androsten-3-one Testosteron testosterone testosteronum Androderm 17beta-hydroxyandrost-4-en-3-one TESTOSTERONE Testosterone |
|
charge |
0 |
|
database_cross_reference |
KEGG:D00075 LIPID_MAPS_instance:LMST02020002 KNApSAcK:C00003675 HMDB:HMDB0000234 PMID:24498482 PMID:18900503 PDBeChem:TES Beilstein:3653705 Gmelin:538843 Wikipedia:Testosterone Reaxys:1915399 Beilstein:1915399 PMID:11786693 Drug_Central:2607 KEGG:C00535 PMID:10438974 DrugBank:DB00624 CAS:58-22-0 |
|
definition |
An androstanoid having 17beta-hydroxy and 3-oxo groups, together with unsaturation at C-4-C-5.. |
|
formula |
C19H28O2 |
|
has exact synonym |
17beta-hydroxyandrost-4-en-3-one TESTOSTERONE Testosterone testosterone |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_83056 http://purl.obolibrary.org/obo/CHEBI_77746 |
|
has_alternative_id |
CHEBI:45798 CHEBI:15214 CHEBI:26883 CHEBI:9461 |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
testosterona 4-androsten-17beta-ol-3-one 17beta-Hydroxy-4-androsten-3-one 17beta-hydroxy-4-androsten-3-one Testosteron testosterone testosteronum Androderm |
|
has_RxCUI |
10379 |
|
id |
CHEBI:17347 |
|
in_subset | ||
inchi |
InChI=1S/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-17,21H,3-10H2,1-2H3/t14-,15-,16-,17-,18-,19-/m0/s1 |
|
inchikey |
MUMGGOZAMZWBJJ-DYKIIFRCSA-N |
|
label |
Testosterone testosterone |
|
mass |
288.42440 |
|
monoisotopicmass |
288.20893 |
|
notation |
CHEBI:17347 |
|
prefLabel |
Testosterone |
|
smiles |
[H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](O)CC[C@@]21[H] |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_50402 http://purl.obolibrary.org/obo/CHEBI_35343 |