loading...| Preferred Name | phenylalanine | |
| Synonyms |
DL-Phenylalanine Phenylalanin alpha-Amino-beta-phenylpropionic acid fenilalanina F PHE 2-amino-3-phenylpropanoic acid Phenylalanine phenylalanine |
|
| Definitions |
An aromatic amino acid that is alanine in which one of the methyl hydrogens is substituted by a phenyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28044 |
|
| alternative term |
DL-Phenylalanine Phenylalanin alpha-Amino-beta-phenylpropionic acid fenilalanina F PHE 2-amino-3-phenylpropanoic acid Phenylalanine phenylalanine |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:1910407 CAS:150-30-1 Gmelin:50836 PMID:17439666 PMID:22264337 Wikipedia:Phenylalanine KEGG:C02057 Beilstein:1910407 |
|
| formula |
C9H11NO2 |
|
| has exact synonym |
2-amino-3-phenylpropanoic acid Phenylalanine phenylalanine |
|
| has part | ||
| has role | ||
| has_alternative_id |
CHEBI:25984 CHEBI:8089 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
DL-Phenylalanine Phenylalanin alpha-Amino-beta-phenylpropionic acid fenilalanina F PHE |
|
| id |
CHEBI:28044 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12) |
|
| inchikey |
COLNVLDHVKWLRT-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| label |
phenylalanine |
|
| mass |
165.18918 |
|
| monoisotopicmass |
165.07898 |
|
| notation |
CHEBI:28044 |
|
| prefLabel |
phenylalanine |
|
| smiles |
NC(Cc1ccccc1)C(O)=O |
|
| textual definition |
An aromatic amino acid that is alanine in which one of the methyl hydrogens is substituted by a phenyl group. |
|
| subClassOf |