loading...| Preferred Name | testosterone | |
| Synonyms |
4-androsten-17beta-ol-3-one testosteronum 17beta-hydroxy-4-androsten-3-one Testosteron testosterone testosterona Androderm 17beta-Hydroxy-4-androsten-3-one Testosterone 17beta-hydroxyandrost-4-en-3-one TESTOSTERONE |
|
| Definitions |
An androstanoid having 17beta-hydroxy and 3-oxo groups, together with unsaturation at C-4-C-5.. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17347 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:24498482 Beilstein:3653705 PMID:10438974 PDBeChem:TES HMDB:HMDB0000234 Wikipedia:Testosterone DrugBank:DB00624 KEGG:D00075 PMID:11786693 Drug_Central:2607 Gmelin:538843 KEGG:C00535 PMID:18900503 Reaxys:1915399 KNApSAcK:C00003675 LIPID_MAPS_instance:LMST02020002 CAS:58-22-0 |
|
| definition |
An androstanoid having 17beta-hydroxy and 3-oxo groups, together with unsaturation at C-4-C-5.. |
|
| formula |
C19H28O2 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_83056 http://purl.obolibrary.org/obo/CHEBI_77746 |
|
| has_alternative_id |
CHEBI:45798 CHEBI:9461 CHEBI:26883 CHEBI:15214 |
|
| has_exact_synonym |
Testosterone 17beta-hydroxyandrost-4-en-3-one TESTOSTERONE testosterone |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
4-androsten-17beta-ol-3-one testosteronum 17beta-hydroxy-4-androsten-3-one Testosteron testosterone testosterona Androderm 17beta-Hydroxy-4-androsten-3-one |
|
| id |
CHEBI:17347 |
|
| in_subset | ||
| inchi |
InChI=1S/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-17,21H,3-10H2,1-2H3/t14-,15-,16-,17-,18-,19-/m0/s1 |
|
| inchikey |
MUMGGOZAMZWBJJ-DYKIIFRCSA-N |
|
| label |
testosterone |
|
| mass |
288.42440 |
|
| monoisotopicmass |
288.20893 |
|
| notation |
CHEBI:17347 |
|
| prefLabel |
testosterone |
|
| smiles |
[H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](O)CC[C@@]21[H] |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_50402 http://purl.obolibrary.org/obo/CHEBI_35343 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_50402 http://purl.obolibrary.org/obo/CHEBI_35343 |