Preferred Name |
cysteine |
|
Synonyms |
Cysteine cysteine 2-amino-3-sulfanylpropanoic acid 2-Amino-3-mercaptopropionic acid 2-amino-3-mercaptopropanoic acid C Cys Cystein Hcys Zystein cisteina |
|
Definitions |
A sulfur-containing amino acid that is propanoic acid with an amino group at position 2 and a sulfanyl group at position 3. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_15356 |
|
charge |
0 |
|
definition |
A sulfur-containing amino acid that is propanoic acid with an amino group at position 2 and a sulfanyl group at position 3. |
|
formula |
C3H7NO2S |
|
hasAlternativeId |
CHEBI:23508 CHEBI:14061 CHEBI:4050 |
|
hasDbXref |
Beilstein:1721406 Reaxys:1721406 Gmelin:2933 KNApSAcK:C00007323 Wikipedia:Cysteine PMID:25181601 PMID:17439666 KEGG:C00736 KNApSAcK:C00001351 CAS:3374-22-9 |
|
hasExactSynonym |
Cysteine cysteine |
|
hasOBONamespace |
chebi_ontology |
|
hasRelatedSynonym |
2-amino-3-sulfanylpropanoic acid 2-Amino-3-mercaptopropionic acid 2-amino-3-mercaptopropanoic acid C Cys Cystein Hcys Zystein cisteina |
|
id |
CHEBI:15356 |
|
inchi |
InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6) |
|
inchikey |
XUJNEKJLAYXESH-UHFFFAOYSA-N |
|
inSubset | ||
label |
cysteine cysteine |
|
mass |
121.15922 |
|
monoisotopicmass |
121.01975 |
|
notation |
CHEBI:15356 |
|
prefLabel |
cysteine |
|
smiles |
NC(CS)C(O)=O |
|
subClassOf |