Link to this page
Cell Culture Ontology
Preferred Name | folic acid | |
Synonyms |
(2S)-2-(4-{[(2-amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}benzamido)pentanedioic acid pteroyl-L-glutamic acid vitamin B11 acido folico acidum folicum pteroyl-L-monoglutamic acid pteroylmonoglutamic acid acide folique N-pteroyl-L-glutamic acid N-[(4-{[(2-amino-4-oxo-1,4-dihydropteridin-6-yl)methyl]amino}phenyl)carbonyl]-L-glutamic acid pteroylglutamic acid Acfol Folate Folicet Folsaeure PGA PteGlu folic acid vitamin B9 vitamin Bc vitamin Be vitamin M N-(4-{[(2-amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamic acid |
|
Definitions |
An N-acyl-amino acid that is a form of the water-soluble vitamin B9. Its biologically active forms (tetrahydrofolate and others) are essential for nucleotide biosynthesis and homocysteine remethylation. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_27470 |
|
charge |
0
|
|
database_cross_reference |
KEGG:D00070 PMID:9683174 AGR:IND606960789 PMID:9781393 ChemIDplus:59-30-3 PMID:9040515 PMID:34219855 PMID:15990733 PMID:10897644 PMID:24650098 PMID:15797531 PMID:11959400 PMID:10958818 PMID:9808640 PMID:33965562 PMID:16093404 Drug_Central:1231 HMDB:HMDB0000121 LINCS:LSM-5355 MeSH:D005492 DrugBank:DB00158 PMID:17784727 ChEMBL:18788725 KEGG COMPOUND:C00504 CiteXplore:17784727 PMID:15754725 KNApSAcK:C00001539 PMID:11451208 PMID:18788725 CAS:59-30-3 PMID:11261364 PMID:10138938 PMID:15797685 PMID:9808641 PMID:8235383 PMID:19121630 PMID:16871332 NIST Chemistry WebBook:59-30-3 KEGG:C00504 Chemspider:5815 PMID:19335717 PMID:19355913 PMID:34207319 MetaCyc:CPD-12826 PMID:15523939 PMID:15321809 PMID:15831910 PMID:16380297 PMID:33624660 Reaxys:100781 PMID:33968971 KEGG COMPOUND:59-30-3 Wikipedia:Folic_Acid PDBeChem:FOL PMID:9565830 PMID:7738698 SNOMEDCT:63718003 PMID:16277678 FooDB:FDB014504 PMID:9420019 Beilstein:100781 PMID:14387833 NCIt:C510
|
|
definition |
An N-acyl-amino acid that is a form of the water-soluble vitamin B9. Its biologically active forms (tetrahydrofolate and others) are essential for nucleotide biosynthesis and homocysteine remethylation.
|
|
formula |
C19H19N7O6
|
|
has characteristic | ||
has_alternative_id |
CHEBI:42610 CHEBI:569217 CHEBI:24075 CHEBI:5140
|
|
has_exact_synonym |
N-(4-{[(2-amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamic acid
|
|
has_obo_namespace |
chebi_ontology
|
|
has_related_synonym |
(2S)-2-(4-{[(2-amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}benzamido)pentanedioic acid pteroyl-L-glutamic acid vitamin B11 acido folico acidum folicum pteroyl-L-monoglutamic acid pteroylmonoglutamic acid acide folique N-pteroyl-L-glutamic acid N-[(4-{[(2-amino-4-oxo-1,4-dihydropteridin-6-yl)methyl]amino}phenyl)carbonyl]-L-glutamic acid pteroylglutamic acid Acfol Folate Folicet Folsaeure PGA PteGlu folic acid vitamin B9 vitamin Bc vitamin Be vitamin M
|
|
has_role | ||
id |
CHEBI:27470
|
|
in_subset | ||
inchi |
InChI=1S/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t12-/m0/s1
|
|
inchikey |
OVBPIULPVIDEAO-LBPRGKRZSA-N
|
|
label |
folic acid
|
|
mass |
441.39750
|
|
monoisotopicmass |
441.13968
|
|
notation |
CHEBI:27470
|
|
preferred label |
folic acid
|
|
prefLabel |
folic acid
|
|
smiles |
Nc1nc2ncc(CNc3ccc(cc3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)nc2c(=O)[nH]1
|
|
subClassOf |
Delete | Subject | Author | Type | Created |
---|---|---|---|---|
No notes to display |