loading...| Preferred Name | gamma-aminobutyric acid | |
| Synonyms |
gamma-aminobutanoic acid GAMMA-AMINO-BUTANOIC ACID omega-aminobutyric acid 4-Aminobutyric acid InChIKey=BTCSSZJGUNDROE-UHFFFAOYSA-N InChI=1S/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7) gamma-Aminobuttersaeure piperidinic acid 4-aminobutyric acid 4-aminobutanoic acid 4-Aminobutanoic acid gamma-amino-n-butyric acid piperidic acid 4Abu C4H9NO2 GABA NCCCC(O)=O gamma-aminobutyric acid gamma-Aminobutyric acid |
|
| Definitions |
A gamma-amino acid that is butanoic acid with the amino substituent located at C-4. An amino fatty acid composed of butanoic acid with the amino substituent at C-4. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_16865 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:D00058 KEGG:C00334 LIPID_MAPS_instance:LMFA01100039 PMID:10630630 PMID:21614609 MetaCyc:4-AMINO-BUTYRATE Drug_Central:1262 Wikipedia:Gamma-Aminobutyric_acid Beilstein:906818 PDBeChem:ABU PMID:10930630 CAS:56-12-2 KNApSAcK:C00001337 PMID:22770225 Gmelin:49775 HMDB:HMDB0000112 Reaxys:906818 PMID:16276116 DrugBank:DB02530 BPDB:2298 |
|
| definition |
A gamma-amino acid that is butanoic acid with the amino substituent located at C-4. An amino fatty acid composed of butanoic acid with the amino substituent at C-4. |
|
| formula |
C4H9NO2 |
|
| has characteristic |
http://purl.obolibrary.org/obo/CHEBI_25512 http://purl.obolibrary.org/obo/CHEBI_75772 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_25512 http://purl.obolibrary.org/obo/CHEBI_75772 |
|
| has_alternative_id |
CHEBI:20318 CHEBI:40483 CHEBI:193777 CHEBI:1786 |
|
| has_exact_synonym |
gamma-aminobutyric acid gamma-Aminobutyric acid 4-aminobutanoic acid |
|
| has_functional_parent | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
gamma-aminobutanoic acid GAMMA-AMINO-BUTANOIC ACID omega-aminobutyric acid 4-Aminobutyric acid InChIKey=BTCSSZJGUNDROE-UHFFFAOYSA-N InChI=1S/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7) gamma-Aminobuttersaeure piperidinic acid 4-aminobutyric acid 4-aminobutanoic acid 4-Aminobutanoic acid gamma-amino-n-butyric acid piperidic acid 4Abu C4H9NO2 GABA NCCCC(O)=O |
|
| id |
CHEBI:16865 |
|
| in_subset | ||
| inchi |
InChI=1S/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7) |
|
| inchikey |
BTCSSZJGUNDROE-UHFFFAOYSA-N |
|
| is_conjugate_acid_of | ||
| is_tautomer_of | ||
| label |
gamma-aminobutyric acid |
|
| mass |
103.11980 |
|
| monoisotopicmass |
103.06333 |
|
| notation |
CHEBI:16865 |
|
| prefLabel |
gamma-aminobutyric acid |
|
| smiles |
NCCCC(O)=O |
|
| subClassOf |