loading...| Preferred Name | cisplatin | |
| Synonyms |
[PtCl2(NH3)2] Peyrone's salt cisplatinum Lederplatin cis-diammineplatinum(II) dichloride cis-Diamminedichloroplatinum(II) cis-diamminedichloroplatinum cis-dichlorodiammineplatinum(II) cis-[PtCl2(NH3)2] Peyrone's chloride Briplatin CDDP Cismaplat Neoplatin Platamine Platinex Platinol Randa cis-DDP cis-platin cisplatin cisplatine cisplatino (SP-4-2)-diamminedichloridoplatinum cis-diamminedichloroplatinum(II) cis-diamminedichloridoplatinum(II) (SP-4-2)-diamminedichloroplatinum Cisplatin |
|
| Definitions |
A diamminedichloroplatinum compound in which the two ammine ligands and two chloro ligands are oriented in a cis planar configuration around the central platinum ion. An anticancer drug that interacts with, and forms cross-links between, DNA and proteins, it is used as a neoplasm inhibitor to treat solid tumours, primarily of the testis and ovary. Commonly but incorrectly described as an alkylating agent due to its mechanism of action (but it lacks alkyl groups). |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_27899 |
|
| charge |
0 |
|
| database cross reference |
DrugBank:DB00515 Wikipedia:Cisplatin PMID:18472761 KEGG:D00275 PMID:23604226 PMID:12537968 Gmelin:2519 PMID:23651576 PMID:28494534 PMID:12831510 Reaxys:11324567 MetaCyc:CPD0-1392 PMID:1855275 PMID:16327988 Patent:DE2318020 PMID:12935404 KEGG:C06911 PMID:23554447 CAS:15663-27-1 Patent:DE2329485 HMDB:HMDB0014656 PMID:10883661 MolBase:25 |
|
| definition |
A diamminedichloroplatinum compound in which the two ammine ligands and two chloro ligands are oriented in a cis planar configuration around the central platinum ion. An anticancer drug that interacts with, and forms cross-links between, DNA and proteins, it is used as a neoplasm inhibitor to treat solid tumours, primarily of the testis and ovary. Commonly but incorrectly described as an alkylating agent due to its mechanism of action (but it lacks alkyl groups). |
|
| formula |
Cl2H6N2Pt H6Cl2N2Pt |
|
| fromOldVersion |
yes |
|
| has_alternative_id |
CHEBI:23314 CHEBI:3722 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
[PtCl2(NH3)2] Peyrone's salt cisplatinum Lederplatin cis-diammineplatinum(II) dichloride cis-Diamminedichloroplatinum(II) cis-diamminedichloroplatinum cis-dichlorodiammineplatinum(II) cis-[PtCl2(NH3)2] Peyrone's chloride Briplatin CDDP Cismaplat Neoplatin Platamine Platinex Platinol Randa cis-DDP cis-platin cisplatin cisplatine cisplatino |
|
| hasExactSynonym |
(SP-4-2)-diamminedichloridoplatinum cis-diamminedichloroplatinum(II) cis-diamminedichloridoplatinum(II) (SP-4-2)-diamminedichloroplatinum Cisplatin |
|
| id |
CHEBI:27899 |
|
| imported from | ||
| in subset | ||
| inchi |
InChI=1S/2ClH.2H3N.Pt/h2*1H;2*1H3;/q;;;;+2/p-2 |
|
| inchikey |
LXZZYRPGZAFOLE-UHFFFAOYSA-L |
|
| label |
cisplatin |
|
| mass |
300.04452 |
|
| monoisotopicmass |
298.95560 |
|
| notation |
CHEBI:27899 |
|
| note |
A diamminedichloroplatinum compound in which the two ammine ligands and two chloro ligands are oriented in a cis planar configuration around the central platinum ion. An anticancer drug that interacts with, and forms cross-links between, DNA and proteins, it is used as a neoplasm inhibitor to treat solid tumours, primarily of the testis and ovary. Commonly but incorrectly described as an alkylating agent due to its mechanism of action (but it lacks alkyl groups). |
|
| preferred label |
cisplatin |
|
| prefLabel |
cisplatin |
|
| smiles |
[H][N]([H])([H])[Pt](Cl)(Cl)[N]([H])([H])[H] |
|
| textual definition |
A diamminedichloroplatinum compound in which the two ammine ligands and two chloro ligands are oriented in a cis planar configuration around the central platinum ion. An anticancer drug that interacts with, and forms cross-links between, DNA and proteins, it is used as a neoplasm inhibitor to treat solid tumours, primarily of the testis and ovary. Commonly but incorrectly described as an alkylating agent due to its mechanism of action (but it lacks alkyl groups). |
|
| subClassOf |