Link to this page
BioModels Ontology
Last uploaded:
April 3, 2012
Jump to:
| Preferred Name | folic acid | |
| Synonyms |
|
|
| Definitions |
Folic acid is a form of the water-soluble vitamine B9. Its biologically active forms (tetrahydrofolate and others) are essential for nucleotide biosynthesis and homocysteine remethylation. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_27470 |
|
| alternative term |
Folic acid C19H19N7O6 Pteroylglutamic acid vitamin Bc PGA vitamin M Nc1nc2ncc(CNc3ccc(cc3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)nc2c(=O)[nH]1 pteroyl-L-monoglutamic acid FOLIC ACID InChIKey=OVBPIULPVIDEAO-LBPRGKRZSA-N Folsaeure PteGlu InChI=1S/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t12-/m0/s1 N-pteroyl-L-glutamic acid pteroyl-L-glutamic acid N-[(4-{[(2-amino-4-oxo-1,4-dihydropteridin-6-yl)methyl]amino}phenyl)carbonyl]-L-glutamic acid Folate N-(4-{[(2-amino-4-oxo-3,4-dihydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamic acid
|
|
| definition |
Folic acid is a form of the water-soluble vitamine B9. Its biologically active forms (tetrahydrofolate and others) are essential for nucleotide biosynthesis and homocysteine remethylation.
|
|
| has functional parent | ||
| has role | ||
| label |
folic acid
|
|
| prefixIRI |
CHEBI:27470
|
|
| prefLabel |
folic acid
|
|
| subClassOf |
Add comment
| Delete | Subject | Author | Type | Created |
|---|---|---|---|---|
| No notes to display |
Create mapping