Jump to:
loading...| Preferred Name | hydroquinone | |
| Synonyms |
|
|
| Definitions |
Aromatic compound comprising benzene core carrying two hydroxy substituents para to each other. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17594 |
|
| alternative term |
1,4-Benzenediol Hydroquinone Benzene-1,4-diol 4-Hydroxyphenol InChIKey=QIGBRXMKCJKVMJ-UHFFFAOYSA-N C6H6O2 p-hydroxyphenol Eldoquin 1,4-Dihydroxybenzene p-Benzenediol Quinol benzene-1,4-diol InChI=1S/C6H6O2/c7-5-1-2-6(8)4-3-5/h1-4,7-8H Oc1ccc(O)cc1 |
|
| definition |
Aromatic compound comprising benzene core carrying two hydroxy substituents para to each other. |
|
| label |
hydroquinone |
|
| prefixIRI |
CHEBI:17594 |
|
| prefLabel |
hydroquinone |
|
| subClassOf |
Create mapping