Jump to:
loading...| Preferred Name | uracil | |
| Synonyms |
|
|
| Definitions |
A common and naturally occurring pyrimidine derivative in which the pyrimidine ring is substituted with two oxo groups at positions 2 and 4. Found in RNA, it base pairs with adenine and replaces thymine during DNA transcription. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17568 |
|
| alternative term |
2,4(1H,3H)-pyrimidinedione InChIKey=ISAKRJDGNUQOIC-UHFFFAOYSA-N Ura C4H4N2O2 Urazil Uracil O=c1cc[nH]c(=O)[nH]1 InChI=1S/C4H4N2O2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8) U URACIL 2,4-dioxopyrimidine pyrimidine-2,4(1H,3H)-dione |
|
| definition |
A common and naturally occurring pyrimidine derivative in which the pyrimidine ring is substituted with two oxo groups at positions 2 and 4. Found in RNA, it base pairs with adenine and replaces thymine during DNA transcription. |
|
| is tautomer of | ||
| label |
uracil |
|
| prefixIRI |
CHEBI:17568 |
|
| prefLabel |
uracil |
|
| subClassOf |
Create mapping