Jump to:
loading...| Preferred Name | alditol | |
| Synonyms |
|
|
| Definitions |
Acyclic polyols having the general formula HOCH2[CH(OH)]nCH2OH (formally derivable from an aldose by reduction of the carbonyl group). |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17522 |
|
| alternative term |
C3H8O3 Glycitol InChI=1S/C3H8O3/c4-1-3(6)2-5/h3-6H,1-2H2 alditols Alditol C2H6O2(CH2O)n Sugar alcohol InChIKey=PEDCQBHIVMGVHV-UHFFFAOYSA-N |
|
| definition |
Acyclic polyols having the general formula HOCH2[CH(OH)]nCH2OH (formally derivable from an aldose by reduction of the carbonyl group). |
|
| label |
alditol |
|
| prefixIRI |
CHEBI:17522 |
|
| prefLabel |
alditol |
|
| subClassOf |
Create mapping